Tải bản đầy đủ

Phân dạng và hướng dẫn giải các bài tập cơ bản ôn tập cho học sinh yếu, kém trước khi kiểm tra 1 tiết lần 1 khối 12

BẢN MÔ TẢ SÁNG KIẾN
Mã số: …………………
1.Tên sáng kiến: Phân dạng và hướng dẫn giải các bài tập cơ bản ôn tập cho học
sinh yếu, kém trước khi kiểm tra 1 tiết lần 1 khối 12.
2. Lĩnh vực áp dụng sáng kiến
- Giáo dục.
3. Mô tả bản chất của sáng kiến
3.1. Tình trạng giải pháp đã biết
- Nhiều học sinh có học lực yếu kém rất khó khăn trong việc giải các bài tập trong lớp,
không có định hướng trong cách giải bài tập. Bị mất kiến thức nên việc giải bài tập cũng
như ghi nhớ những kiến thức rất khó. Không nắm được những nội dung trọng tâm của
chương trình do đó không có định hướng trong cách học cũng như ôn tập khi kiểm tra.
- Học sinh có học lực yếu kém gặp nhiều khó khăn và không thể tiếp thu hết những bài
tập, những nội dung quan trọng mà giáo viên đã truyền đạt. Nên kết quả kiểm tra thường
thấp và làm cho học sinh cảm thấy chán nản trong việc học tập của bộ môn.
3.2. Nội dung giải pháp đề nghị công nhận là sáng kiến
- Kiến thức bộ môn hóa có liên quan rất nhiều với nhau ở từng bài và từng chương làm
cho học sinh gặp lúng túng trong việc giải quyết một bài tập vì không có phương pháp
giải và không có định hướng giải như thế nào, phải áp dụng kiến thức nào.
- Việc phân dạng và hướng dẫn giải các dạng bài tập cơ bản thường gặp sẽ giúp học sinh
có nhiều cơ hội rèn luyện những kỹ năng giải bài tập tốt hơn và cũng như định hướng

trong việc ôn tập những kiến thức cũ giúp học sinh nắm rõ hơn về nội dung chương trình
từ đó học sinh có phương hướng học và ôn tập tốt hơn để kiểm tra đạt kết quả tốt hơn và
say mê hơn trong học tập bộ môn.
- Cách thức thực hiện: trước khi chuẩn bị kiểm tra 1 tiết lần 1 khối 12. Chúng ta lọc danh
sách những học sinh có học lực yếu kém bộ môn hóa. Thành lập lớp phụ đạo và phụ đạo
cho học sinh khoảng 2 buổi (4 - 6 tiết) để củng cố lại những nội dung cốt lõi, quan trọng
của chương.
+ Buổi 1: Giải các dạng bài tập cơ bản thường gặp. Giáo viên đưa ra từng dạng bài tập có

1


tóm tắt lý thuyết liên qua đến cách giải bài tập. Sau đó, giáo viên giải mẫu 2 bài và cho
học sinh giải các câu bài tập còn lại của dạng. Giáo viên kiểm tra giám sát quá trình làm
bài của các em để có hướng dẫn cụ thể hơn cho từng học sinh và kịp thời điều chỉnh lại
những lỗi để học sinh ghi nhớ kiến thức. Cứ theo trình tự hết dạng 1 rồi tới dạng 2, … Ở
mỗi dạng để lại khoảng 2 – 3 câu để học sinh về nhà làm bài.
+ Buổi 2: Giáo viên sửa các bài tập về nhà. Cho học sinh làm ôn tập cả bài tập và lý
thuyết. Giáo viên sửa bài và giải thích lại thật kỹ cho học sinh nắm vững kiến thức. Cuối
buổi có thể cho một bài kiểm tra ngắn để nắm được tình hình học sinh nắm kiến thức như
thế nào.
3.3. Khả năng áp dụng của giải pháp
- Dùng để ôn tập cho học sinh có học lực yếu kém trước khi kiểm tra để học sinh nắm
vững lại những kiến thức và định hướng lại nội dung trọng tâm cho học sinh có cơ sở học
bài và ôn tập trước kiểm tra.
- Ngoài chương này chúng ta cũng có thể soạn và thực hiện ở các chương khác để học
sinh làm vững kiến thức, có kết quả tốt hơn trong các bài kiểm tra và giúp học sinh say
mê hơn trong việc học tập bộ môn.
3.4. Hiệu quả, lợi ích thu được hoặc dự kiến có thể thu được do áp dụng giải pháp
- Sau khi áp dụng giải pháp ta thu được kết quả rất khả quan, thúc đẩy học sinh chủ động
hơn trong việc học tập và giúp học sinh có phương pháp giải bài tập để có thể giải quyết
các chương khác.
- Kết quả trước và sau khi thực hiện giải pháp
Trước khi thực hiện
Từ 0 đến nhỏ hơn 3,5: 6 học sinh
Từ 3,5 đến nhỏ hơn 5,0: 14 học sinh
Từ 5,0 đến nhỏ hơn 6,5: 19 học sinh
Từ 6,5 đến nhỏ hơn 8,0: 5 học sinh
Từ 8,0 trở lên: 0 học sinh
3.5. Tài liệu kèm theo:



Sau khi thực hiện
Từ 0 đến nhỏ hơn 3,5: 5 học sinh
Từ 3,5 đến nhỏ hơn 5,0: 5 học sinh
Từ 5,0 đến nhỏ hơn 6,5: 16 học sinh
Từ 6,5 đến nhỏ hơn 8,0: 12 học sinh
Từ 8,0 trở lên: 6 học sinh

PHÂN DẠNG VÀ HƯỚNG DẪN GIẢI CÁC BÀI TẬP CƠ BẢN ÔN TẬP CHO
HỌC SINH YẾU, KÉM TRƯỚC KHI KIỂM TRA 1 TIẾT LẦN 1 KHỐI 12
A. PHẦN BÀI TẬP
Dạng 1: Gọi tên và viết phương trình (este có dạng RCOOR’)
Tóm tắt lý thuyết

2


Tên este = Tên gốc ankyl (R’) + tên gốc axit (RCOO-)
Một số tên gốc ankyl và gốc axit thường gặp
Tên gốc axit (RCOO-)

Tên gốc ankyl (R’)

HCOO- : fomat (fomiat)

-CH3: metyl

CH3COO- : axetat

-CH2CH3: etyl

CH3CH2COO- : propionat

-CH2CH2CH3: propyl

CH3CH2CH2COO- : butyrat

-CH(CH3)2: isopropyl

C6H5COO- : benzoat

-CH=CH2: vinyl

CH2=CH-COO- : acrylat

-CH2-CH=CH2: anlyl

CH2=C(CH3)COO- : metacrylat

-CH2CH2CH(CH3)2: isoamyl

COOoxalat
COO-

-C6H5: phenyl
-CH2C6H5: benzyl

Phương trình phản ứng
- Phản ứng thủy phân (H+, t0) (có tính thuận nghịch)

-Phản ứng thủy phân trong môi trường bazơ (phản ứng xà phòng hóa: phản ứng một
chiều)
RCOOR’ + NaOH → RCOONa + R’OH
VD1: CH3COOCH3: metyl axetat
VD2: CH3COOCH3 + NaOH → CH3COONa + CH3OH
VD3: CH3COOCH3 + H2O

CH3COOH + CH3OH

Bài tập áp dụng
Câu 1: Gọi tên các este sau:
HCOOCH3

CH3COOC2H5

CH2=CH-COOCH3

CH2=CH-COOCH=CH2

CH2=C(CH3)-COOCH3

CH3CH2COOCH(CH3)2

C6H5COOC2H5

C6H5COOC6H5

CH3(CH2)2COOCH2C6H5

CH2=C(CH3)-COOC6H5

Câu 2: Viết CTCT với các tên sau:
Etyl acrylat

phenyl axetat

Isoamyl fomat

benzyl propionat

3


vinyl metacrylat

Etilen glycol điaxetat

isobutyl acrylat
Câu 3: Viết phương trình phản ứng xãy ra khi cho các este sau tham gia phản ứng thủy
phân trong môi trường axit và trong môi trường kiềm (dd NaOH):
a/ etyl axetat

b/ propyl fomat

c/ benzyl metacrylat

d/ vinyl axetat

d/ phenyl axetat

e/ anlyl benzoat

Dạng 2: Xác định đồng phân và CTCT
Tóm tắt lý thuyết
- Este no, đơn chức, mạch hở: CnH2nO2 (n ≥ 2) hay CnH2n+1COOCmH2m+1 (n ≥ 0, m ≥ 1).
- Este đơn chức: CxHyO2 hay RCOOR’.
- Este không no, có 1 liên kết đôi, đơn chức: CnH2n-2O2 (n ≥ 3).
- Este được tạo từ axit đa chức và ancol đơn chức: R(COOR’) n.
- Este được tạo từ axit đơn chức và ancol đa chức: (RCOO) nR’.
- Số đồng phân axit = 2n-3 ( n<6).
- Số đồng phân este no, đơn chức, mạch hở là: 2n-2 (n: là số C) (n< 5) riêng C5H10O2 là 9
đồng phân.
- Este tham gia phản ứng tráng gương: HCOOR’.
- Sản phẩm thủy phân este tham gia phản ứng tráng gương: HCOOR’ hoặc
RCOOCH=CH-R’.
- 2 sản phẩm thủy phân este đều tham gia phản ứng tráng gương: HCOOCH=CH-R’.
VD1: Este C3H6O2 có bao nhiêu đồng phân cấu tạo ?
A. 1.

B. 2.

C. 3.

D. 4.

Giải
Viết đồng phân HCOOCH2-CH3 và CH3-COO-CH3.
Hoặc có thể tính nhanh số đồng phân este no đơn chức: 2n-2 = 21 = 2 đồng phân.
Chọn B.
VD2: Este C4H8O2 có bao nhiêu đồng phân cấu tạo ?
A. 5.

B. 2.

C. 3.

Giải
Viết đồng phân HCOOCH2-CH2-CH3; HCOO-CH(CH3)-CH3; CH3-COO-CH2-CH3
và CH3-CH2-COO-CH3.

4

D. 4.


Hoặc có thể tính nhanh số đồng phân este no đơn chức: 2n-2 = 22 = 4 đồng phân.
Chọn D.
Bài tập áp dụng
Câu 1. Este C5H8O2 có bao nhiêu đồng phân cấu tạo ?

A. 5.

B. 8.

C. 6.

D. 4.

C. 7.

D. 8.

Câu 2. Este C4H6O2 có bao nhiêu đồng phân cấu tạo ?

A. 5.

B. 6.

Câu 3. Một este X đơn chức, mạch hở có tỉ khối hơi so với oxi là 3,125, khi tham gia

phản ứng xà phòng hóa thu được một anđehit và một muối của axit hữu cơ. Có bao nhiêu
CTCT phù hợp với X ?
A. 2.

B. 5.

C. 3.

D. 4.

Câu 4. Thủy phân este C4H6O2 trong môi trường axit ta thu được hỗn hợp các chất đều

tham gia phản ứng tráng gương. CTCT của este là
A. CH2=CHCOOCH3.

B. HCOOC(CH3)=CH2.

C. HCOO-CH=CH-CH3.

D. CH3COOCH=CH2.

Câu 5. Thủy phân este X có công thức là C4H8O2 (với xúc tác là axit) thu được 2 sản

phẩm hữu cơ A và B. Từ A có thể điều chế trực tiếp ra B. Vậy X là
A. Metyl propionat.

B. Etyl axetat.

C. Propyl fomat.

D. Isopropyl fomat.

Câu 6. Một este C4H6O2 thủy phân trong môi trường axit thu được một axetanđehit.

CTCT của este là
A. CH2=CHCOOCH3.

B. HCOOC(CH3)=CH2.

C. HCOO-CH=CH-CH3.

D. CH3COOCH=CH2.

Câu 7. Hai este X và Y là đồng phân của nhau. Khi hóa hơi 1,85 gam X thu được thể

tích hơi đúng bằng thể tích của 0,7 gam N2 (ở cùng điều kiện). CTCT của X và Y là
A. HCOOC2H5 và CH3COOCH3.

B. C2H3COOC2H5 và C2H5COOC2H3.

C. C2H5COOCH3 và HCOOCH(CH3)2.

D. HCOOCH2CH2CH3 và CH3COOC2H5.

Câu 8. Cho chất X tác dụng với một lượng vừa đủ dd NaOH, sau đó cô cạn dd thu được

chất rắn Y và chất hữu cơ Z. Cho Z tác dụng với lượng AgNO3/NH3 thu được chất hữu cơ
T. Cho chất T tác dụng với dd NaOH lại thu được hợp chất Y. Chất X có thể là
A. HCOOCH=CH2.

B. CH3COOCH=CH2.

C. HCOOCH3.

D. CH3COOCH=CH-CH3.

Dạng 3: Đốt cháy este

5


Tóm tắt lý thuyết
CnH2nO2 +

O2

nCO2 + nH2O

- Nếu

 este no, đơn chức, mạch hở.

- Nếu

 este không no,

- Công thức tính số C và số H trong HCHC:
- Nếu đốt cháy CnH2nO2 rồi hấp thụ hoàn toàn sản phẩm cháy vào bình đựng dd kiềm

+ Nếu qua dd Ca(OH)2, Ba(OH)2 khối lượng dd
Tăng: ∆m = (mCO2 + mH2O) - m↓

Giảm: ∆m = m↓ -(mCO2 + mH2O)

+ Nếu lọc bỏ kết tủa đun nóng thu được kết tủa nữa thì nCO 2 = n↓(1) + 2n↓(2).
- Nếu bài toán đốt cháy nhiều este là đồng phân của nhau thì có thể quy về 1 este để giải.
- Có thể áp dụng ĐLBT nguyên tố (áp dụng cho oxi) để giải
n O(este) + n O(O2) = n O(CO2) + n O(H2O).
VD1: Đốt cháy hoàn toàn 0,11g este thì thu được 0,22g CO2 và 0,09g H2O. Số đồng phân
của chất này là
A. 3.

B. 4.

C. 5.

Giải
Số mol CO2 = Số mol H2O = 0,005 mol Suy ra este no, đơn chức, mạch hở.
CnH2nO2 +
0,11 gam

O2

nCO2 + nH2O
0,005 mol

Ta có tỉ lệ: (14n + 32)/0,11 = n/0,005 → n = 4
CTPT: C4H8O2.
Số đồng phân = 24-2 =4 đồng phân.
Chọn B

6

D. 6.


VD2: Đốt cháy hoàn toàn a g hỗn hợp các este no, đơn chức, mạch hở. Sản phẩm cháy
được dẫn qua bình đựng dd Ca(OH)2 lấy dư thấy khối lượng bình tăng thêm 6,2 g. Số mol
CO2 và số mol H2O sinh ra lần lượt là
A. 0,10 và 0,10.

B. 0,2 và 0,2.

C. 0,10 và 0,01.

D. 0,05 và 0,05.

Vì este no, đơn chức, mạch hở nên nCO2 = nH2O = 6,2/62 = 0,1 mol
Chọn A
Bài tập áp dụng
Câu 1. Đốt cháy hoàn toàn 1 g một este X đơn chức, mạch hở, có một nối đôi C=C thu

được 1,12 lít khí CO2 (đktc) và 0,72g H2O. Công thức phân tử của X là
A. C4H8O2

B. C5H10O2

C. C4H6O2

D. C5H8O2

Câu 2. Đốt cháy hoàn toàn một lượng hỗn hợp 2 este, cho sản phẩm phản ứng cháy qua

bình đựng P2O5 dư, khối lượng bình tăng thêm 6,21 gam, sau đó cho qua tiếp dung dịch
Ca(OH)2 dư, thu được 34,5 gam kết tủa. Các este trên thuộc loại gì? (đơn chức hay đa
chức, no hay không no).
A. Este thuộc loại no

B. Este thuộc loại không no

C. Este thuộc loại no, đơn chức

D. Este thuộc loại không no đa chức

Câu 3. Đốt cháy hoàn toàn a gam hỗn hợp các este no, đơn chức mạch hở. Sản phẩm cháy

được dẫn vào bình đựng dung dịch Ca(OH)2 dư thấy khối lượng bình tăng 12,4 gam.
Khối lượng kết tủa tạo ra là
A. 12,40 gam

B. 10,00 gam

C. 20,00 gam

D. 28,18 gam

Câu 4. Đốt cháy hoàn toàn 6 gam một este X thu được 4,48 lít khí CO 2 (đktc) và 3,6 gam

H2O. Công thức phân tử của X là
A. C4H8O2.

B. C3H6O2.

C. C2H4O2.

D. C4H6O2.

Câu 5. Đốt cháy hoàn toàn 0,88 gam 2 este đồng phân thu được 1,76 gam CO2 và 0,72

gam H2O. Công thức phân tử của 2 este là
A. C4H8O2.

B. C3H6O2.

C. C5H10O2.

Dạng 4: Phản ứng thủy phân (xà phòng hóa)
Tóm tắt lý thuyết

RCOOR’ + NaOH → RCOONa + R’OH
Số chức este = nNaOH / neste.

7

D. C4H6O2.


- Nếu este đơn chức thì neste = nNaOH = nRCOONa = nR’OH.
- Nếu xà phòng hóa este đơn chức bằng NaOH mà khối lượng muối > khối lượng este 
gốc R’ là CH3.
VD1: X là một chất hữu cơ no, đơn chức có M = 88. Nếu đem đun 2,2 gam este X với
dung dịch NaOH dư, thu được 2,4 gam muối. Công thức cấu tạo thu gọn của chất nào sau
đây phù hợp với X:
A. HCOOCH2CH2CH3.

B. CH2CH2CH3COOH.

C. C2H5COOCH3.

D. HCOOCH(CH3)2.

Giải
Meste = 88 đvC → CTPT: C4H8O2.
neste = 2,2/88 = 0,025 mol
RCOOR’ + NaOH → RCOONa + R’OH
0,025

0,025

Mmuối = 2,4/0,025 = 96 → R = 29 (C2H5)
Vậy CTCT este là: C2H5COOCH3.
Chọn C
VD2 : Cho 4,2g este đơn chức no E tác dụng hết với dung dịch NaOH ta thu được 4,76g
muối natri. Vậy công thức cấu tạo của E có thể là:
A CH3COOCH3

B. HCOOCH3

C. CH3COOC2H5.

D. HCOOC2H5

Giải
Este thủy phân bằng dd NaOH mà m muối > meste → R’ là CH3.
RCOOCH3 + NaOH → RCOONa + CH3OH
4,2 gam

4,76 gam

Ta có tỉ lệ: (R + 59)/4,2 = (R + 67)/4,76 → R = 1 (H)
Vậy este là HCOOCH3.
Chọn B.
Bài tập áp dụng
Câu 1. X là một este no đơn chức, có tỉ khối hơi đối với CH4 là 5,5. Nếu đem đun

2,2 gam este X với dung dịch NaOH (dư), thu được 2,05 gam muối. Công thức cấu tạo
thu gọn của X là:
A. C2H5COOCH3.

B. HCOOCH2CH2CH3.

8


C. CH3COOC2H5

D.HCOOCH(CH3)2.

Câu 2. Cho 8,6g este X bay hơi thu được 4,48 lít hơi X ở 2730C và 1 atm. Mặt khác cho

8,6g X tác dụng vừa đủ với dung dịch NaOH thì thu được 8,2g muối. Công thúc cấu tạo
đúng của X là
A. H-COOCH2-CH=CH2

B. CH3-COOCH2-CH3

C. H-COOCH2-CH2-CH3

D. CH3-COOCH=CH2

Câu 3. Hỗn hợp X gồm 2 este đơn chức A và B hơn kém nhau một nhóm -CH2- Cho

6,6g hỗn hợp X tác dụng vừa đủ với 100ml dung dịch NaOH 1M thu được 7,4g hỗn hợp
2 muối. Công thức cấu tạo chính xác của A và B là
A. CH3-COOC2H5 và H-COOC2H5

B. CH3-COO-CH=CH2 và H-COO-CH=CH2

C. CH3-COOC2H5 và CH3-COOCH3

D. H-COOCH3 và CH3-COOCH3

Câu 4. Cho 6g một este của axit cacboxylic no đơn chức và ancol no đơn chức phản ứng

hết với 100ml dung dịch NaOH 1M. Tên gọi của este đó là
A. etyl axetat

B. metyl fomiat

C. metyl axetat

D. propyl fomiat

Câu 5. Xà phòng hoá 22,2g hỗn hợp hai este là HCOOC 2H5 và CH3COOCH3 đã dung

vừa hết 200ml dung dịch NaOH. Nồng độ mol của dung dịch NaOH là
A. 0,5M

B. 1,0M

C. 1,5M

D. 2,0M

Câu 6. Cho 4,4g este đơn chức no E tác dụng hết với dung dịch NaOH ta thu được 4,8g

muối natri. Công thức cấu tạo của E có thể là
A. CH3COOCH3

B. C2H5COOCH3

C. CH3COOC2H5

D. HCOOC2H5

Câu 7. Xà phòng hoá a gam hỗn hợp hai este là HCOOC 2H5 và CH3COOCH3 cần 300ml

dung dịch NaOH nồng độ 1M. Giá trị của a là
A. 14,8g

B. 18,5g

C. 22,2g

D. 29,6g

Câu 8. Cho 0,1mol este A tác dụng vừa đủ với dung dịch chứa 0,2 mol NaOH thu được

hỗn hợp hai muối của hai axit hữu cơ đều đơn chức và 6,2g một ancol B. Vậy công thức
của B là
A. C2H4(OH)2 B. CH2(CH2OH)2

C. CH3-CH2-CH2OH

D. CH3-CH2-CHOH-CH2OH

Câu 9. Cho 10,4g hỗn hợp X gồm axit axetic và este etyl axetat tác dụng vừa đủ với

150g dung dịch natri hiđroxit 4%. Phần trăm khối lượng của etyl axetat trong hỗn hợp
bằng
A. 33,3%

B. 42,3%

C. 57,6%

Dạng 5: Bài toán có liên quan đến hiệu suất

9

D. 39,4%


Tóm tắt lý thuyết
H = (thực tế/lý thuyết).100
Tính lượng truớc phản ứng = (? .100)/H
Tính lượng sau phản ứng = (?.H)/100
VD1: Đun nóng 18g axit axetic với 9,2g ancol etylic có mặt H2SO4 đặc có xúc tác. Sau
phản ứng thu được 12,32g este. Hiệu suất của phản ứng là
A. 35,42 %

B. 46,67%

C. 70,00%

D. 92,35%

Giải
nCH3COOH = 18/60 = 0,3 mol
nC2H5OH = 9,2/46 = 0,2 mol
nCH3COOC2H5 = 12,32/88 = 0,14 mol
CH3COOH + C2H5OH
0,3 mol

CH3COOC2H5 + H2O

0,2 mol

0,2 mol

H = (0,14/0,2).100 = 70%
Chọn C
VD2: Khối lượng este metyl metacrylat thu được là bao nhiêu khi đun nóng 215 gam axit
metacrylic với 96 gam ancol metylic, giả thiết hiệu suất phản ứng este hoá đạt 60%.
A. 180 gam

B. 186gam

C. 150 gam

D. 119 gam

Giải
naxit = 215/86 = 2,5 mol
nancol = 96/32 = 3 mol
CH2=C(CH3)-COOH + CH3OH
2,5 mol

CH2=C(CH3)-COO-CH3 + H2O

3 mol

2,5 mol

Meste = 2,5.100. 60/100 = 150 gam
Chọn C
Bài tập áp dụng
Câu 1. Đun 12 gam axit axetic với 13,8 gam etanol (có H2SO4 đặc làm xúc tác) đến khi

phản ứng đạt tới trạng thái cân bằng, thu được 11 gam este. Hiệu suất của phản ứng este
hoá là
A. 50%

B. 55%

C. 75%

10

D. 62,5%


Câu 2. Đun nóng axit axetic với ancol isoamylic (CH3)2CHCH2CH2OH có H2SO4 đặc xúc

tác thu được isoamyl axetat (dầu chuối). Tính lượng dầu chuối thu được từ 132,35 g axit
axetic đun nóng với 200 g ancol isoamylic? Biết hiệu suất phản ứng đạt 68%.
A. 292,5 g

B. 421,7 g

C. 195,0 g

D. 226,0 g

Câu 3. Cho 3 gam CH3COOH và 3,2g CH3OH vào một bình pu có axit sunfuric đặc làm

xúc tác, sau pu thu được m gam este. Biết hiệu suất pu đạt 80%. Giá trị của m là
A. 2,96g

B. 3,7g

C. 7,4g

D. 5,92g

Câu 4. Đun nóng 6,0 gam CH3COOH với 6,0 gam C2H5OH ( có H2SO4 làm xúc tác, hiệu

suất phản ứng este hoá bằng 50%). Khối lượng este tạo thành là
A.6,0 gam

B.4,4 gam

C.8,8 gam

D.5,2 gam

Câu 5. Cho 0,1 mol axit đơn chức X phản ứng với 0,15 mol rượu đơn chức Y thu được

4,5gam este với hiệu suất 75%. Vậy tên gọi của este ?
A. Metyl fomiat

B. Metyl axetat

C. Etyl axetat

D.metyl propionat

Câu 6. Đun nóng 30kg axit axetic với 92kg ancol etylic. Khối lượng etylaxetat tạo thành

với H%= 75% là :
A. 38,5kg

B. 33,0kg

C. 30,5kg

D. 25,65kg

Câu 7. Để điều chế este metyl metacrylat người ta cho 17,2g axit tương ứng và 9,6g

ancol tương ứng tác dụng với nhau trong điều kiện thích hợp thu được 14g este. Hiệu suất
của phản ứng là:
A. 75%

B. 70%

C. 65%

D. 60%

Câu 8. Đun nóng gồm 0,04 mol CH3COOH và 0,05 mol C2H5OH thu được este. Cho

toàn bộ lượng este tác dụng với 50ml NaOH 1M thu được 3,26g chất rắn. Hiệu suất phản
ứng este hóa là:
A. 75%

B. 60%

C. 80%

D. 62,5%

Câu 9. Đun nóng 18g axit axetic với 9,2 g ancol etylic có mặt H2SO4 đặc làm xúc tác.

Sau phản ứng thu được 12,3 gam este. Hiệu suất của phản ứng là:
A. 35,42%

B. 46,67%

C. 70,00%

D. 92,35%

Câu 10. Sản phẩm của phản ứng thủy phân metyl axetat có 3,2 g ancol metylic. Biết rằng

hiệu suất của phản ứng này là 80%. Khối lượng của metyl axetat đem thủy phân là bao
nhiêu ?
A. 11g

B. 9,25g

C. 7,4g

Dạng 6: Lipit

11

D. 5,92g


Tóm tắt lý thuyết
Lipit (chất béo, triglixerit) là trieste của glixerol (glixerin) với các axit mạch thẳng (axit
béo).
CH3(CH2)14COOH (C15H31COOH (M=256)): Axit panmitic
CH3(CH2)16COOH (C17H35COOH (M=284)): Axit stearic
CH3(CH2)7CH=CH(CH2)7COOH (C17H33COOH (M=282)): Axit oleic
CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH (C17H31COOH (M=280)): Axit linoleic
(C17H35COO)3C3H5: Tristearin (M = 890)

(C17H33COO)3C3H5: Triolein (M = 884)

(C15H31COO)3C3H5: Tripanmitin (M = 806)

(C17H31COO)3C3H5: Trilinolein (M = 878)

- Chất béo no: chất rắn (mỡ cừu, bò).
- Chất béo không no: chất lỏng (lạc, vừng).
- Số đồng phân triglixerit tạo từ n axit béo tối đa là n2.(n + 1)/2.
- Phản ứng thủy phân chất béo
(RCOO)3C3H5 + 3NaOH → 3RCOONa + C3H5(OH)3
- Khối lượng xà phòng tính bằng ĐLBTKL hoặc công thức tính nhanh
Khối lượng xà phòng= m chất béo + 28/3.số mol NaOH
Khối lượng xà phòng= m chất béo + 76/3.số mol KOH
- Phản ứng hidro hóa đối với chất béo không no (hidro hóa chất béo).
(C17H33COO)3C3H5 + 3H2 → (C17H35COO)3C3H5
VD1: Xà phòng hoá hoá hoàn toàn 89g chất béo X bằng dung dịch NaOH thu được 9,2g
glixerol. Số gam xà phòng thu được là
A. 91,8g

B. 83,8g

C. 79,8g

D. 98,2g

Giải
nglixerol = 9,2/92 = 0,1 mol
(RCOO)3C3H5 + 3NaOH → 3RCOONa + C3H5(OH)3
89 gam

0,3 mol

m gam

0,1 mol

ĐLBTKL: 89 + 0,3.40 = m + 0,1.92 → m = 91,8 gam
Chọn A
VD2: Hiđro hoá hoàn toàn m(g) triolein thì thu được 89g tristearin. Giá trị m là
A. 84,8g

B. 88,4g

C. 48,8g

Giải
ntristearin = 89/890 = 0,1 mol

12

D. 88,9g


(C17H33COO)3C3H5 + 3H2 → (C17H35COO)3C3H5
0,1 mol

0,1 mol

mtriolein = 0,1.884 = 88,4 gam
Chọn B
Bài tập áp dụng
Câu 1. Cho 0,25 mol NaOH vào 20g lipit trung tính và nước rồi đun lên. Khi phản ứng

xong hoàn toàn người ta thu được hỗn hợp có tính bazơ, muốn trung hòa phải dùng 0,18
mol HCl. Khối lượng NaOH cần để xà phòng hóa một tấn chất béo là
A. 350 kg.

B. 35 kg.

C. 140 kg.

D. 70 kg

Câu 2. Cho 45 gam trieste của glixerol với một axit béo tác dụng vừa đủ với 100 ml

dung dịch NaOH 1,5M được m1 gam xà phòng và m2 gam glixerol. Giá trị m1, m2 là
A. m1 = 46,4; m2 = 4,6.

B. m1 = 4,6; m2 = 46,4.

C. m1 = 40,6; m2 = 13,8.

D. m1 = 15,2; m2 = 20,8.

Câu 3. Xà phòng hoá hoàn toàn 17,24 gam chất béo cần vừa đủ 0,06 mol NaOH. Cô cạn

dung dịch sau phản ứng thu được khối lượng xà phòng là
A. 17,80 gam.

B. 18,38 gam.

C. 18,24 gam.

D. 16,68 gam.

Câu 4. Xà phòng hóa hoàn toàn 89g chất béo cần vừa đủ 12g NaOH . Khối lượng xà

phòng thu được là
A. 101g

B. 91,8g

C. 92,3g

D. 90,5g

Câu 5. Để xà phòng hóa 10Kg chất béo ( R-COO) 3C3H5 người ta đun chất béo với dd

chứa 1.37 kg NaOH. Lượng NaOH dư được trung hòa bởi 500 ml dd HCl 1M. Tính khối
lượng glixerol và xà phong thu được?
A. 1.035 kg Glixerol và 11.225 kg xà phòng B. 1.05 kg glixerol và 10.315 kg xà phòng
C. 1.035 kg glixerol và 10.315 kg xà phòng

D. 1.05 kg glixerol và 11.225 kg xà phòng

Câu 6. Cho 178kg chất béo trung tính phản ứng vừa đủ với 120kg dung dịch NaOH

20%. Giả sử phản ứng xảy ra hoàn toàn. Khối lượng xà phòng thu được là:
A. 61,2kg

B. 183,6kg

C. 122,4kg

D. Một giá trị khác

Dạng 6: Cacbohiđrat
Tóm tắt lý thuyết
- Cacbohidrat (gluxit, đường,saccarit) là HCHC tạp chức, phân tử có chứa nhóm OH
(hidroxyl), có công thức chung Cn(H2O)m.
- Cacbohidrat chia làm 3 loại:

13


+ Monosaccarit (glucozơ, fructozơ): không thể thủy phân.
+ Đisaccarit (saccarozơ, mantozơ): thủy phân cho ra 2 phân tử monosaccarit.

+ Polisaccarit (tinh bột, xenlulozơ): thủy phân cho ra nhiều phân tử monosaccarit.
Đặc

MONOSACCARIT
GLUCOZƠ (C6H12O6)
FRUCTOZƠ (C6H12O6)
điểm
- Glucozơ và fructozơ là đồng phân của nhau.
- CTCT CH2OH-(CHOH)3-CO-CH2OH
1. Cấu - CTCT CH2OH-(CHOH)4-CHO
- Phân tử chứa 5 nhóm OH và 1 nhóm
- Phân tử chứa 5 nhóm OH và 1 nhóm
tạo
CHO.
- Glucozơ có chủ yếu trong nho nên còn

CO.
- Fructozơ có chủ yếu trong mật ong nên

được gọi là đường nho.

còn được gọi là đường mật ong.

- Glucozơ tồn tại ở dạng mạch hở và hai - Fructozơ cũng tồn tại ở dạng mạch hở và
dạng mạch vòng gồm α-glucozơ và β- vòng.
2.

glucozơ.

TCVL - Trong dung dịch, hai dạng vòng chiếm - Fructozơ có thể tồn tại ở dạng mạch
ưu thế và luôn chuyển hóa lẫn nhau theo vòng 5 cạnh hoặc 6 cạnh, dạng 2 cạnh có
một cân bằng qua dạng mạch hở.

năm đồng phân là α và β.

- Nồng độ glucozơ trong máu ổn định
3.

0,1%.
1. Phản ứng xảy ra ở nhóm OH

1. Phản ứng xảy ra ở nhóm OH

TCHH - Tác dụng với Cu(OH)2 ở nhiệt độ

- Tác dụng với Cu(OH)2 ở nhiệt độ thường

thường tạo dd màu xanh lam (chứng tỏ

tạo dd màu xanh lam (chứng tỏ fructozơ

glucozơ có nhiều nhóm OH liên tiếp)

có nhiều nhóm OH liên tiếp)

2C6H12O6 + Cu(OH)2 → (C6H11O6)2Cu +

2C6H12O6 + Cu(OH)2 → (C6H11O6)2Cu +

2H2O.

2H2O.

- Glucozơ có thể tạo este 5 gốc axit

- Fructozơ có thể tạo este 5 gốc axit axetic

axetic (tác dụng với anhiđric axetic

(tác dụng với anhiđric axetic (CH3CO)2O).

(CH3CO)2O).

- Ngoài ra còn tác dụng với kim loại kiềm.

- Ngoài ra còn tác dụng với kim loại
kiềm.

14


2. Phản ứng xảy ra ở nhóm CHO.

2. Phản ứng xảy ra ở nhóm CHO.
Phân tử fructozơ không có nhóm CHO
nhưng trong môi trường kiềm fructozơ sẽ
có thể chuyển hóa về thành glucozơ.

- Phản ứng tráng gương (td với dd

- Phản ứng tráng gương (td với dd

AgNO3/NH3)

AgNO3/NH3)

CH2OH[CHOH]4CHO + 2AgNO3 +

CH2OH[CHOH]4CHO + 2AgNO3 + 2NH3

2NH3 + H2O →

+ H2O → CH2OH[CHOH]4COONH4 +

CH2OH[CHOH]4COONH4 + 2Ag +

2Ag + 2NH4NO3.

(amoni gluconat)

Có thể viết gọn: Fructozơ → 2Ag↓.

2NH4NO3.

Có thể viết gọn: Glucozơ → 2Ag↓.
- Phản ứng với dd Cu(OH)2/OH-

- Phản ứng với dd Cu(OH)2/OH-

CH2OH[CHOH]4CHO + 2Cu(OH)2 +

CH2OH[CHOH]4CHO + 2Cu(OH)2 +

NaOH → CH2OH[CHOH]4COONa +

NaOH → CH2OH[CHOH]4COONa +

Cu2O↓ + H2O.

Cu2O↓ + H2O.

Có thể viết gọn: Glucozơ → Cu2O↓ (đỏ

Có thể viết gọn: Fructozơ → Cu2O↓ (đỏ

gạch).

gạch).

- Phản ứng với hidro (Ni, to)

- Phản ứng với hidro (Ni, to)

C6H12O6 + H2→ C6H14O6 (sobitol).

C6H12O6 + H2→ C6H14O6 (sobitol).

- Phản ứng với dd brom.

- Fructozơ không tác dụng với dd

CH2OH[CHOH]4CHO + H2O + Br2 →

brom.

CH2OH[CHOH]4COOH + 2HBr.
Axit gluconic
Glucozơ làm mất màu dd brom. Dùng
dd brom để phân biệt glucozơ và
fructozơ.
- Phản ứng lên men:
C6H12O6 → 2C2H5OH + 2CO2.
- Thủy phân tinh bột hoặc xenlulozơ
4. Điều trong môi trường axit.
chế
(C6H10O5)n + H2O
nC6H12O6.
ĐISACCARIT

15


Đặc
điểm
1. Cấu
tạo
2.
TCVL

SACCAROZƠ (C12H22O11)

MANTOZƠ (C12H22O11)

Saccarozơ và mantozơ là đồng phân của nhau.
- Saccarozơ mạch vòng, cấu tạo bởi 1
- Mantozơ mạch vòng, cấu tạo bởi 2 gốc
gốc α-glucozơ và 1 gốc β-fructozơ.
- Saccarozơ có nhiều trong mía, củ cải

α-glucozơ.
- Mantozơ đuợc gọi là đường mạch nha.

đường nên được gọi là đường mía, hay
đường củ cải.
- Tác dụng với Cu(OH)2 ở nhiệt độ

- Tác dụng với Cu(OH)2 ở nhiệt độ thường

thường tạo dd màu xanh lam.

tạo dd màu xanh lam.

2C12H22O11 + Cu(OH)2 →

2C12H22O11 + Cu(OH)2 → (C12H21O11)2Cu

(C12H21O11)2Cu + 2H2O.

+ 2H2O.

- Không phản ứng tráng gương.

- Phản ứng tráng gương. C12H22O11 →
2Ag.

- Không phản ứng với dd Cu(OH)2/OH-.
3.

- Phản ứng với dd Cu(OH)2/OH-.
C12H22O11 → Cu2O.

TCHH - Không phản ứng với hidro (Ni, to).

- Phản ứng với hidro (Ni, to).

- Không phản ứng với dd brom.

- Phản ứng với dd brom.

- Thủy phân

- Thủy phân

C12H22O11 + H2O
Saccarozơ

C6H12O6 +
glucozơ

C12H22O11 + H2O

C6H12O6.

Mantozơ

2C6H12O6.
glucozơ

fructozơ - Có tính khử và tính chất hóa học
Đặc
điểm

tương tự như glucozơ.
POLISACCARIT
TINH BỘT (C6H10O5)n
XENLULOZƠ (C6H10O5)n
Tinh bột và xenlulozơ không phải là đồng phân của nhau.

16


1.

- Được cấu tạo bởi hai loại polisaccarit:

- Là polime hợp thành từ các mắt xích β-

amilozơ (mạch không phân nhánh) và

glucozơ bởi các liên kết β-[1-4] glucozit,

amilopectin (mạch phân nhánh).

các mạch không phân nhánh.

- Liên kết giữa các mắc xích trong phân - Mỗi mắt xích C6H10O5 của xenlulozơ có

TCVL tử tinh bột là liên kết α-[1-4] glucozit và ba nhóm –OH tự do.
α-[1-6] glucozit.

- Có phản ứng với nước Swayde:
Cu(OH)2/NH3.
- Công thức cấu tạo [C6H7O2(OH)3]n.
- Phản ứng thủy phân

- Thủy phân
(C6H10O5)n + H2O

nC6H12O6.

(C6H10O5)n + H2O

nC6H12O6.

- Nhỏ iot vào hồ tinh bột tạo thành màu

- Phản ứng với HNO3đặc trong H2SO4

tím.

đặc.
[C6H7O2(OH)3]n + 3nHNO3
[C6H7O2(NO3)3]n + 3nH2O.

2.

(xenlulozơ trinitrat)

TCHH

Xenlulozơ trinitrat dùng làm thuốc súng
không khói.
- Tạo este khi tác dụng với anhidric axetic
tương tự như tác dụng với HNO3.
[C6H7O2(OH)3]n + 3n(CH3CO)2O →
[C6H7O2(CH3COO)3]n + 3nCH3COOH.
(xenlulozơ triaxetat)

3. Điều - Tổng hợp tinh bột
chế
6nCO2 + 5nH2O (C6H10O5)n + 6nO2.
- Tóm tắt tính chất hóa học của cacbohidrat được tóm tắt trong bảng sau:
Glucozơ
x
x
x

Fructozơ
x

Saccarozơ

Mantozơ
x
x
x
x

Tinh bột

AgNO3/NH3
CH3OH/HCl
Cu(OH)2
x
x
+
H2O/H
x
x
I2
x
Swayde
- Chú ý khi đốt cháy cacbohidrat: Cn(H2O)m + nO2 → nCO2 + mH2O.

17

Xenlulozơ

x
x


Số mol CO2 bằng số mol O2. Có thể tính khối lượng cacbohidrat bằng ĐLBTKL hoặc
ĐLBT nguyên tố.
Tìm công thức cacbohidrat ta tìm tỉ lệ n/m = ?
- Một số dạng tóan CO2 tác dụng với dung dịch Ca(OH)2.
+ Dẫn tòan bộ khí CO2 qua nước vôi trong dư thu được m gam kết tủa CaCO3.

nCO2  nCaCO3
+ Dẫn toàn bộ khí CO2 qua nước vôi trong thì thu được m1 gam kết tủa và dung dịch A.
Đun nóng dung dịch A lại thu được m2 gam kết tủa. nCO2  nCaCO3 (1)  2.nCaCO3 (2)
+ Dẫn toàn bộ khí CO2 qua nước vôi trong thì thu được m1 gam kết tủa và dung dịch A.
Cho thêm Ca(OH)2 đến dư vào dung dịch A lại thu được m2 gam kết tủa.

nCO  nCaCO (1)  nCaCO (2)
2

3

3

+ Dẫn toàn bộ khí CO2 qua nước vôi trong thì thu được m1 gam kết tủa và dung dịch sau
phản ứng giảm b gam so với ban đầu. mCO2  mCaCO3  b
+ Dẫn toàn bộ khí CO2 qua nước vôi trong thì thu được m1 gam kết tủa và dung dịch sau
phản ứng tăng b gam so với ban đầu. mCO2  mCaCO3  b
- Một số công thức tính
n = (C% . mdd)/(100.M)
a0 = Vnguyên chất.100/ Vdd
mdd =V(ml).d(g/ml)
n = (a0.d.V)/(100.M)
n = (C%.d.V)/(100.M)
a0 : độ rượu
d : khối lượng riêng
VD1: Khối lượng xenlulozơ cần để sản xuất 1 tấn xenlulozơ trinitrat biết hao hụt trong
sản xuất là 10%.
A. 0,6061 tấn

B. 1,65 tấn

C. 0,491 tấn

Giải
nxenlulozơ trinitrat = 1/297
[C6H7O2(OH)3]n + 3nHNO3

[C6H7O2(NO3)3]n + 3nH2O.

18

D. 0,60 tấn


1/297

1/297

mxenlulozơ = (1/297).162.100/90= 0,6061 tấn
Chọn A
VD2 : Cho 5,4 gam glucozơ phản ứng hoàn toàn với dung dịch AgNO3/NH3 (dư) thì khối
lượng Ag thu được là
A. 2,16 gam

B. 3,24 gam

C. 4,32 gam

D. 6,48 gam

Giải
nC6H12O6 = 5,4/180 = 0,03 mol
C6H12O6 + 2AgNO3/NH3 → 2Ag
0,03

0,06

mAg = 0,06.108 = 6,48 gam
Chọn D
Bài tập áp dụng
Câu 1. Đun nóng dung dịch chứa 27 gam glucozơ với AgNO3/NH3, giả sử hiệu suất phản

ứng là 75% thấy Ag kim loại tách ra. Khối lượng Ag kim loại thu được là
A. 24,3 gam

B. 32,4 gam

C. 16,2 gam

D. 21,6 gam.

Câu 2. Xenlulozơ trinitrat được điều chế từ xenlulozơ và axit nitric đặc có xúc tác axit

sunfuric đặc,nóng. Để có 29,7 kg xenlulozơ trinitrat, cần dùng dung dịch chứa m kg axit
nitric (hiệu suất phản ứng đạt 90%). Giá trị của m là
A. 42 kg

B. 10 kg.

C. 30 kg.

D. 21 kg

Câu 3. Cho m gam tinh bột lên men thành ancol (rượu) etylic với hiệu suất 81%. Toàn bộ

lượng CO2 sinh ra được hấp thụ hoàn toàn vào dung dịch Ca(OH) 2, thu được 550 gam kết
tủa và dung dịch X. Đun kỹ dung dịch X thu thêm được 100 gam kết tủa. Giá trị của m là
A. 550.

B. 810.

C. 650.

D. 750

Câu 4. Từ 16,20 tấn xenlulozơ người ta sản xuất được m tấn xenlulozơ trinitrat (biết hiệu

suất phản ứng tính theo xenlulozơ là 90%). Giá trị của m là:
A. 26,73.

B. 33,00.

C. 25,46.

D. 29,70

Câu 5. Khối lượng của tinh bột cần dùng trong quá trình lên men để tạo thành 5 lít rượu

(ancol)etylic 46º là (biết hiệu suất của cả quá trình là 72% và khối lượng riêng của rượu
etylic nguyên chất là0,8 g/ml)
A. 5,4 kg.

B. 5,0 kg.

C. 6,0 kg.

19

D. 4,5 kg.


Câu 6. Thể tích dung dịch HNO3 67,5% (khối lượng riêng là 1,5 g/ml) cần dùng để tác

dụng với xenlulozơ tạo thành 89,1 kg xenlulozơ trinitrat là (biết lượng HNO 3 bị hao hụt
là 20 %)
A. 55 lít.

B. 81 lít.

C. 49 lít.

D. 70 lít

Câu 7. Lên men m gam glucozơ với hiệu suất 90%. Lượng CO2 sinh ra được hấp thụ vào

dung dịch Ca(OH)2 thu được 10 gam kết tủa và khối lượng dung dịch giảm 3,4 gam. Giá
trị của m là
A. 30.

B. 15.

C. 17.

D. 34.

Câu 8. Lên men m(g) glucozo với hiệu suất 90% , lượng CO2 sinh ra cho vào nước vôi

trong thu được 15g kết tủa và khối lượng dung dịch giảm 5,1g. Giá trị m là:
A. 20,25

B. 22,5g

C. 30

D. 45

Câu 9. Cho 10 kg glucozơ chứa 10% tạp chất lên men thành ancol etylic. Trong quá trình

chế biến, ancol bị hao hụt 5%. Hỏi khối lượng ancol etylic thu được bằng bao nhiêu?
A. 4,65kg

B. 4,37kg

C. 6.84kg

D. 5.56kg

Câu 10. Muốn sản xuất 59,4kg xenlulozơ trinitrat với hiệu xuất phản ứng 90% thì thể tích

dd HNO3 99,67% (D=1,52g/ml) cần dùng là
A. 27,23 lít

B. 27,732 lít

C. 28 lít

D. 27,723 lít

Câu 11. Xenlulozơ trinitrat là chất dễ cháy, nổ mạnh, được điều chế từ xenlulozơ và axit

nitric. Muốn điều chế 29,7kg xenlulozơ trinitrat (hiệu suất 90%) thì thể tích axit nitric
96% (D=1,52g/ml) cần dùng là bao nhiêu?
A. 14,39lít

B. 15lít

C. 14,5lít

D. 15,5 lít

Câu 12. Thuỷ phân 1 kg khoai có chứa 20% tinh bột trong môi trường axit. Nếu hiệu suất

của quá trình là 75% thì khối lượng glucozơ thu được là
A. 166,67g.

B. 200g.

C. 150g.

D. 1000g.

Câu 13. Cho 10 kg glucozơ chứa 10% tạp chất lên men thành rượu. Tính thể tích rượu 46 0

thu được. Biết rượu nguyên chất có khối lượng riêng 0,8 g/ml và trong quá trình chế biến
rượu bị hao hụt mất 5%.
A. 11,875 lít.

B. 2,785 lít.

C. 2,185 lít.

D. 3,875 lít.

Câu 14. Thuỷ phân hoàn toàn 62,5 gam dung dịch saccarozơ 17,1% trong môi trường axit

(vừa đủ) được dung dịch X. Cho dung dịch AgNO3/NH3 vào X và đun nhẹ được m gam
Ag. Giá trị của m là
A. 6,75.

B. 13,5.

C. 10,8.

20

D. 7,5.


B. PHẦN LÝ THUYẾT
Câu 1. Cho các chất sau: CH3OH (1); CH3COOH (2); HCOOC2H5 (3). Thứ tự nhiệt độ

sôi giảm dần là
A. (3);(1);(2).

B. (2);(1);(3).

C. (1);(2);(3).

D. (2);(3);(1).

C. CH3COOC2H5.

D. HCOOC2H5.

Câu 2. Metyl fomat có công thức phân tử là:

A. HCOOCH3.

B. CH3COOCH3.

Câu 3. Khẳng định nào sau đây không đúng ?

A. CH3COOCH = CH2 cùng dãy đồng đẳng với CH2 = CHCOOCH3
B. CH3CH2COOCH=CH2 tác dụng đựơc với dung dịch NaOH thu được anđehit và muối
C. CH3COOCH = CH2 tác dụng được với dung dịch Br2.
D. CH3COOCH = CH2 có thể trùng hợp tạo polime.
Câu 4. Phát biểu nào sau đây không đúng ?

A. Mỡ động vật chủ yếu cấu thành từ các axit béo, no, tồn tại ở trạng thái rắn
B. Dầu thực vật chủ yếu chứa các axit béo không no, tồn tại ở trạng thái lỏng
C. Hiđro hóa dầu thực vật lỏng sẽ tạo thành các mỡ động vật rắn
D. Chất béo nhẹ hơn nước và không tan trong nước
Câu 5. Chất béo là este được tạo bởi :

A. Glixerol với axit axetic.

B. Ancol etylic với axit béo.

C. Glixerol với các axit béo.

D. Các phân tử aminoaxit.

Câu 6. Quá trình nào không tạo ra CH3CHO?

A. Cho vinyl axetat vào dung dịch NaOH

B. Cho C2H2 vào dung dịch HgSO4 đun nóng

C. Cho ancol etylic qua bột CuO, to

D. Cho metyl acrylat vào dung dịch NaOH

Câu 7. Cho các chất: CH3COOC2H5, C6H5NH2, C2H5OH, C6H5CH2OH, C6H5OH,

C6H5NH3Cl, số chất tác dụng với dung dịch NaOH là
A. 1

B. 2

C. 3

D. 4

Câu 8. Thuỷ phân lipit trong môi trường kiềm thì thu được ancol nào trong các ancol

sau?
A. CH2(OH)-CH2-CH2OH

C. CH2(OH)-CH(OH)-CH3

B. CH2(OH)-CH2OH.

D. CH2(OH)CH(OH)CH2OH.

Câu 9. Este tạo bởi ancol no, đơn chức và axit đơn chức không no có một liên kết đôi

C=C. Có công thức tổng quát là
A. CnH2n-4 O2 ( n  4). B. CnH2n-2 O2 ( n  3). C. CnH2n-2 O2 ( n  4). D. CnH2nO2 ( n  4).

21


Câu 10. Cho phản ứng xà phòng hoá sau :

(C17H35COO)3C3H5 + 3NaOH

3C17H35COONa + C3H5(OH)3

 

Trong các chất trên chất nào được coi là xà phòng
A. C3H5(OH)3

B. NaOH

C. C17H35COONa

D. (C17H35COO)3C3H5

Câu 11. Dầu mỡ (chất béo)để lâu ngày bị ôi thiu là do

A. Chất béo vữa ra
B. Chất béo bị oxi hoá chậm trong không khí tạo thành anđehit có mùi
C. Chất béo bị thuỷ phân với nước trong không khí
D. Chất béo bị oxi và nitơ không khí chuyển thành amino axit có mùi khó chịu.
Câu 12. Một este có công thức phân tử là C4H6O2, khi thuỷ phân trong môi trường axit

thu được axetanđehit. Công thức cấu tạo thu gọn của este đó là
A. HCOO-C(CH3)=CH2

B. HCOO-CH=CH-CH3

C. CH3COO-CH=CH2

D. CH2=CH-COO-CH3

Câu 13. Thuỷ phân hỗn hợp metyl axetat và etyl axetat trong dd NaOH đun nóng, sau

phản ứng ta thu được
A. 1 muối và 1 ancol.

B. 1 muối và 2 ancol.

C. 2 muối và 1 ancol.

D. 2 muối và 2 ancol.

Câu 14. Thủy phân este X có CTPT C4H6O2 trong môi trường axit thu được hỗn hợp 2

chất hữu cơ đều có khả năng tham gia phản ứng tráng bạc. CTCT của X là
A. CH3COOCH=CH2.

B. HCOOCH2CH=CH2.

C. HCOOCH=CHCH3.

D. CH2=CHCOOCH3.

Câu 15. Có bao nhiêu trieste của glixerol chứa đồng thời 3 gốc axit C17H35COOH,

C17H33COOH, C15H31COOH?
A. 1.

B. 2.

C. 3.

D. 5.

Câu 16. Este có công thức phân tử CH3COOCH3 có tên gọi là:

A. metyl axetat.

B. vinyl axetat.

C. metyl fomat.

D. metyl propionat.

Câu 17. Phát biểu nào sau đây là không đúng?

A. Phản ứng thuỷ phân este trong môi trường axit có tính thuận nghịch.
B. Công thức chung của este giữa axit no đơn chức và rượu no đơn chức là C nH2n O2 (n ≥
2).
C. phản ứng xà phòng hóa este là phản ứng không có tính thuận nghịch.
D. Este là sản phẩm của phản ứng este hoá giữa axit hữu cơ hoặc axit vô cơ với ancol.

22


Câu 18. Phát biểu nào sau đây là đúng:

A. tất cả các este phản ứng với dung dịch kiềm luôn thu được sản phẩm cuối cùng là
muối và ancol.
B. phản ứng giữa axit hữu cơ và ancol khi có H2SO4 đặc là phản ứng một chiều.
C. khi thủy phân chất béo luôn thu được C2H4(OH)2.
D. phản ứng thủy phân chất béo trong môi trường axit hoặc bazơ luôn thu được glixerol.
Câu 19. Mệnh đề không đúng là:

A. CH3CH2COOCH=CH2 có thể trùng hợp tạo polime.
B. CH3CH2COOCH=CH2 cùng dãy đồng đẳng với CH2 = CHCOOCH3.
C. CH3CH2COOCH=CH2 tác dụng được với dung dịch brom.
D. CH3CH2COOCH=CH2 tác dụng với dung dịch NaOH thu được anđêhit và muối.
Câu 20. Ứng với công thức C4H8O2 có bao nhiêu đồng phân đơn chức?

A. 5

B. 3

C. 6

D. 4

Câu 21. Chất nào sau đây tham gia phản ứng tráng gương:

A. CH3COOH.

B. C3H7COOH.

C. HCOOC3H7.

D. CH3COOCH3.

Câu 22. Số đồng phân este của C4H8O2 là?

A. 4

B. 5

C. 2

D. 3

Câu 23. Hai sản phẩm của phản ứng thủy phân este X (trong môi trường axit) đều tham

gia phản ứng tráng bạc. Công thức phân tử phù hợp với X có thể là
A. C2H6O2.

B. C3H6O2.

C. C2H4O2.

D. C3H4O2.

Câu 24. Ứng với công thức C3H6O2 có bao nhiêu đồng phân tác dụng được với dung

dịch NaOH?
A. 2

B. 3

C. 4

D. 1

Câu 25. Phản ứng nào sau đây xảy ra:

A. CH3COOCH3 + Na.
C. CH3COOCH3 + NaOH.

B. CH3COOH + AgNO3/NH3.
D. CH3OH + NaOH

Câu 26. Phản ứng hóa học đặc trưng của este là:

A. Phản ứng trung hòa.

B. Phản ứng xà phòng hóa.

C. Phản ứng oxi hóa.

D. Phản ứng este hóa.

Câu 27. Câu nhận xét nào sau đây không đúng:

A. este có nhiệt độ sôi thấp vì axit có liên kết hiđrô liên phân tử.
B. Este không tan trong nước vì không tạo được liên kết hiđrô với nước.

23


C. Este sôi ở nhiệt độ thấp hơn axit tạo ra nó vì este dễ bay hơi.
D. Axit sôi ở nhiệt độ cao vì có liên kết hiđrô liên phân tử giữa các phân tử axit.
Câu 28. Có các chất : axit axetic, glixerol, ancol etylic, glucozơ. Chỉ dùng một thuốc

thử nào sau đây để nhận biết
A. Quỳ tím

B. Kim loại Na

C. Dung dịch AgNO3/NH3

D. Cu(OH)2.

Câu 29. Hợp chất hữu cơ X có công thức đơn giản nhất là CH 2O. X có phản ứng tráng

bạc và hoà tan dược Cu(OH)2 cho dung dịch màu xanh lam. X là chất nào cho dưới đây ?
A. Glucozơ

B. Saccarozơ

C. Tinh bột

Câu 30. Chất X là một gluxit có phản ứng thuỷ phân.

D. Xenlulozơ
X + H2 O

 axit
  2Y . X

có CTPT là :
A. C6H12O6

B. (C6H10O5 )n

C. C12H22O11

D. Không xác định đựơc

Câu 31. Saccarozơ có thể tác dụng với chất nào sau đây ?

A. H2 (xúc tác Ni, t0)

B. Dung dịch AgNO3 trong ammoniac

C. Cu(OH)2

D. Tất cả các chất trên

Câu 32. Tinh bột và xenlulozơ khác nhau ở điểm nào ?

A. Thành phần phân tử

B. Cấu tạo phân tử

C. Độ tan trong nước

D. Phản ứng thuỷ phân

Câu 33. Phát biểu nào sau đây không đúng ?

A. Saccarozơ thuộc loại đisaccarit, phân tử được cấu tạo bởi 2 gốc glucozơ
B. Saccarozơ là mantozơ là đồng phân của nhau
C. Saccarozozơ được tạo từ 1 gốc α- glucozơ và một gốc β- fructozơ
D. Saccarozơ là đường mía, đường thốt nốt, đường củ cải, đường phèn
Câu 34. Điều khẳng định nào sau đây không đúng ?

A. Glucozơ và fructozơ là 2 chất đồng phân với nhau
B. Glucozơ và fructozơ đều tác dụng được với Cu(OH) 2/ NaOH
C. Cacbohiđrat còn có tên là gluxit
D. ở dạng mạch hở glucozơ và fructozơ đều có nhóm -CHO
Câu 35. Fructozơ không phản ứng với chất nào sau đây ?

A. Cu(OH)2/NaOH

B. AgNO3/NH3

C. H2 (Ni, t)

D. H2O/H+

Câu 36. Chất nào sau đây phản ứng được với cả Na, Cu(OH) 2 và AgNO3/NH3 ?

A. Etilenglicol

B. Glixerol

C. saccarozơ

24

D. Glucozơ


Câu 37. Cho 5 nhóm chất hữu cơ sau :

1. Glucozơ và anđehit axetic
3. Glucozơ và glixerol

2. Glucozơ và etanol

4. Glucozơ và axit nitric

5. Glucozơ và anđehit fomic.

Thuốc thử nào sau đây có thể phân biệt tất cả các chất trên trong mỗi nhóm ?
A. Na

B. Cu(OH)2/NaOH

C. NaOH

D. AgNO3/NH3

Câu 38. Trong công nghiệp chế tạo ruột phích người ta thường cho chất nào sau đây tác

dụng AgNO3/ddNH3
A. Glucozơ

B. Axit fomic

C. Axetilen

D. Andehit fomic

Câu 39. Dãy chất nào sau đây có phản ứng thủy phân trong môi trường axit ?

A. Tinh bột, xenlulozơ, saccrozơ, chất béo.

B. Tinh bột, xenlulozơ, polivinylaxetat.

C. Tinh bột, xenlulozơ, saccarozơ, thủy tinh hữu cơ.

D. Cả A, B, C.

Câu 40. Một dung dịch có tính chất sau :

Tác dụng được với dung dịch AgNO3/NH3 và Cu(OH)2 khi đun nóng.
Hòa tan được Cu(OH)2 tạo ra dung dịch màu xanh lam.
Bị thủy phân nhờ axit hoặc men enzim.
Dung dịch đó là :
A. Glucozơ

B. Saccarozơ

C. Mantozơ

D. Xenlulozơ

Câu 41. Saccarozơ có thể tác dụng với hoá chất nào dưới đây :(1) Cu(OH) 2,

(2) AgNO3/NH3; (3) H2/Ni, t0 (4) H2SO4 loãng, nóng
A. (1), (4)

B. (2), (3)

C. (1), (2)

D. (3), (4)

Câu 42. Chọn phát biểu sai:

A. Glucozơ là một ancol đa chức
B. Phân tử glucozơ tồn tại cả dạng mạch hở và dạng mạch vòng
C. Glucozơ là một hợp chất tạp chức
D. Trong phân tử glucozơ có 5 nhóm hidroxyl (-OH)
Câu 43. Glucozơ không có tính chất nào dưới đây?

A. Tính chất của nhóm anđehit

B. Tính chất của poliol

C. Tham gia phản ứng thuỷ phân

D. Tác dụng với CH3OH trong HCl

Câu 44. Cho sơ đồ phản ứng: Thuốc súng không khói  X  Y  Sobit. X , Y lần

lượt là
A. xenlulozơ, glucozơ

B. tinh bột, etanol

C. mantozơ, etanol

D. saccarozơ, etanol

25


Tài liệu bạn tìm kiếm đã sẵn sàng tải về

Tải bản đầy đủ ngay

×