Tải bản đầy đủ (.pdf) (160 trang)

20 đề mới NHẤT năm 2020 GIẢI CHI TIẾT TYHH

Bạn đang xem bản rút gọn của tài liệu. Xem và tải ngay bản đầy đủ của tài liệu tại đây (3.33 MB, 160 trang )

SỞ GIÁO DỤC VÀ ĐÀO TẠO
VĨNH PHÚC

ĐỀ THI THỬ THPT QUỐC GIA LẦN 1
THPT NGÔ GIA TỰ
Bài thi: KHOA HỌC TỰ NHIÊN
Môn thi thành phần: HOÁ HỌC
Thời gian làm bài: 50 phút, không kể thời gian phát đề

ĐỀ CHÍNH THỨC
(Đề có 04 trang)
Họ, tên thí sinh: .....................................................................
Mã đề thi 107
Số báo danh: ..........................................................................
* Cho biết nguyên tử khối của các nguyên tố:
H = 1; He = 4; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; S = 32; Cl = 35,5; K = 39; Ca = 40; Cr
= 52; Mn = 55; Fe = 56; Cu = 64; Zn = 65; Br = 80; Ag = 108; Ba = 137.
* Các thể tích khí đều đo ở điều kiện tiêu chuẩn, giả thiết các khí sinh ra không tan trong nước.
Câu 1: Số este có công thức phân tử C4H8O2 là
A. 5.
B. 4.
C. 2.
D. 3.
Câu 2: Cho NH3 dư vào dung dịch chất nào sau đây, thu được kết tủa?
A. ZnCl2.
B. Cu(NO3)2.
C. FeSO4.
D. AgNO3.
Câu 3: Đun este X với dung dịch H2SO4 loãng, thu được dung dịch Y. Trung hòa dung dịch Y rồi thực hiện
phản ứng tráng bạc thấy có kết tủa trắng bạc sinh ra. X là este nào dưới đây?
A. Bezyl axetat.


B. Metyl fomat.
C. Anlyl axetat.
D. Phenyl acrylat.
o
Câu 4: Lên men 12,15 kg tinh bột với hiệu suất 70%, thu được V lít rượu 40 . Giá trị của V gần nhất với
giá trị nào sau đây?
A. 30,8.
B. 21,6.
C. 8,6.
D. 15,1.
Câu 5: Glyxylalanin có công thức là
A. H2N-CH2-CO-NH-CH2-COOH.
B. H2N- CH(CH3)-CO-NH-CH2-COOH.
C. H2N- CH(CH3)-CO-NH-CH(CH3)-COOH.
D. H2N-CH2-CO-NH-CH(CH3)-COOH.
Câu 6: Dãy gồm các chất được xếp theo chiều tính bazơ giảm dần từ trái sang phải là
A. CH3NH2, NH3, C6H5NH2.
B. CH3NH2, C6H5NH2, NH3.
C. C6H5NH2, NH3, CH3NH2.
D. NH3, CH3NH2, C6H5NH2.
Câu 7: Nguyên tử nguyên tố X có tổng số hạt cơ bản (proton, nơtron, electron) là 48. X có số khối chênh
lệch với số khối trung bình không quá 1 đơn vị. X là
A. Si.
B. Cl.
C. S.
D. P.
Câu 8: Đốt cháy hoàn toàn 4,4 gam chất hữu cơ X, thu được 8,8 gam CO2 và 3,6 gam nước. Công thức
đơn giản nhất của X là
A. CH2O.
B. C2H4O2.

C. CH2O2.
D. C2H4O.
Câu 9: Cặp chất nào dưới đây phản ứng được với nhau ở điều kiện thường?
A. P và O2.
B. N2 và Cl2.
C. H2 và O2.
D. H2 và Cl2.
Câu 10: Hằng số cân bằng hóa học phụ thuộc vào yếu tố nào sau đây?
A. Áp suất.
B. Xúc tác.
C. Nhiệt độ.
D. Nồng độ.
Câu 11: Nhận xét nào sau đây đúng?
A. Amophot là phân hỗn hợp.
B. Độ dinh dưỡng của phân đạm được tính bằng hàm lượng %N trong phân đạm.
C. Phân đạm cung cấp nguyên tố dinh dưỡng là K cho cây trồng.
D. Độ dinh dưỡng của phân lân được tính bằng hàm lượng %P trong phân lân.
Câu 12: Từ etilen, có thể điều chế trực tiếp hợp chất nào sau đây?
A. Axit axetic.
B. Metan.
C. Anđehit axetic.
D. Propan.
Câu 13: Stiren có công thức phân tử là
A. C6H8.
B. C8H8.
C. C9H8.
D. C7H7.

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/


TYHH | Page 1


Câu 14: Đốt cháy 3,1 gam P bằng lượng dư O2, cho sản phẩm thu được vào nước, được 200 ml dung dịch
X. Nồng độ mol/l của dung dịch X là
A. 0,5.
B. 0,1.
C. 0,2.
D. 0,25.
Câu 15: Phát biểu nào sau đây đúng?
A. Trong phản ứng tráng bạc, anđehit là chất oxi hóa.
B. Axit fomic không làm mất màu nước brom.
C. Amoni fomat có phản ứng tráng bạc.
D. Ancol bậc ba bị oxi hóa thành xeton.
Câu 16: Cacbohidrat nào dưới đây làm mất màu nước brom?
A. Xenlulozơ.
B. Fructozơ.
C. Glucozơ.
D. Saccarozơ.
Câu 17: Axit propionic có công thức cấu tạo là
A. CH3-CH2-OH.
B. CH3-CH2-COOH.
C. CH2=CH-COOH.
D. CH3-CH2-CHO.
Câu 18: Cho hỗn hợp gồm 0,025 mol Mg và 0,03 mol Al tác dụng với dung dịch HCl dư thu được dung
dịch A. Thêm dung dịch NaOH dư vào dung dịch A, thu được m gam kết tủa. Giá trị của m là
A. 3,49.
B. 16,30.
C. 1,00.
D. 1,45.

Câu 19: Tiến hành thí nghiệm như hình vẽ:
Ban đầu trong cốc chứa nước vôi trong. Sục rất từ từ CO2 vào cốc
cho tới dư. Hỏi độ sáng của bóng đèn thay đổi như thế nào?
A. Tăng dần rồi giảm dần đến tắt.
B. Tăng dần.
C. Giảm dần đến tắt rồi lại sáng tăng dần.
D. Giảm dần đến tắt.
Câu 20: Đun nóng metyl axetat với dung dịch NaOH, thu được muối là
A. CH3OH.
B. CH3COONa.
C. C2H5OH.
D. HCOONa.
Câu 21: Hỗn hợp X gồm alanin và axit glutamic. Cho m gam X tác dụng hoàn toàn với dung dịch NaOH
dư, thu được dung dịch Y chứa (m + 61,6) gam muối. Mặt khác, nếu cho m gam X tác dụng hoàn toàn với
dung dịch HCl dư, thu được dung dịch Z chứa (m + 73) gam muối. Giá trị của m là
A. 224,4.
B. 342,0.
C. 331,2.
D. 247,6.
Câu 22: Thuỷ phân hoàn toàn 1 mol pentapeptit X mạch hở thu được 1 mol glyxin (Gly), 2 mol alanin
(Ala), 2 mol valin (Val). Mặt khác nếu thuỷ phân không hoàn toàn X thu được sản phẩm có chứa Ala-Gly
và Gly-Val. Số công thức cấu tạo phù hợp của X là
A. 6.
B. 4.
C. 2.
D. 8.
Câu 23: Cho 13,35 gam hỗn hợp X gồm hai amin no, đơn chức, mạch hở là đồng đẳng kế tiếp, tác dụng
vừa đủ với dung dịch HCl thấy tạo ra 22,475 gam muối. Đốt cháy hoàn toàn 13,35 gam hỗn hợp X, thu
được tổng khối lượng CO2 và H2O là
A. 47,05 gam.

B. 62,95 gam.
C. 46,35 gam.
D. 38,45 gam.
Câu 24: Cho các phát biểu sau
(1) Trong công nghiệp dược phẩm, saccarozơ được dùng để pha chế thuốc.
(2) Nhỏ vài giọt dung dịch HCl vào dung dịch anilin thấy vẩn đục.
(3) Các este là chất lỏng hoặc rắn ở nhiệt độ thường và tan nhiều trong nước.
(4) Cho Br2 vào dung dịch phenol xuất hiện kết tủa trắng.
(5) Ở điều kiện thích hợp, glyxin phản ứng được với ancol etylic.
Số phát biểu đúng là
A. 6.
B. 4.
C. 5.
D. 3.
Câu 25: Cho 1 mol chất X (C7H6O3, chứa vòng benzen) tác dụng tối đa với 3 mol NaOH trong dung dịch,
thu được 1 mol muối Y; 1 mol muối Z và 2 mol H2O. Số đồng phân cấu tạo thỏa mãn điều kiện trên của X

A. 3.
B. 4.
C. 1.
D. 2.
Câu 26: Cho 0,4 mol hỗn hợp X gồm 2 ancol no, đơn chức, bậc 1, là đồng đẳng kế tiếp đun nóng với
H2SO4 đặc ở 140oC thu được 7,704 gam hỗn hợp 3 ete. Tham gia phản ứng ete hoá có 50% lượng ancol có
khối lượng phân tử nhỏ và 40% lượng ancol có khối lượng phân tử lớn. Tên gọi của 2 ancol trong X là

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 2



A. propan-1-ol và butan-1-ol.
B. pentan-1-ol và butan-1-ol.
C. etanol và propan-1-ol.
D. metanol và etanol.
Câu 27: Cho các chất sau: etyl axetat, vinyl fomat, tripanmitin, triolein, glucozơ, saccarozơ, tinh bột,
xenlulozơ. Số chất tham gia phản ứng thủy phân là
A. 6.
B. 4.
C. 5.
D. 7.
Câu 28: Hợp chất hữu cơ X mạch hở có công thức phân tử C 4H6O4. Biết rằng khi đun X với dung dịch
bazo tạo ra hai muối và một ancol no đơn chức mạch hở. Cho 17,7 gam X tác dụng với 400 ml dung dịch
NaOH 1M, cô cạn dung dịch sau phản ứng thu được m gam chất rắn khan. Giá trị của m là
A. 28,9.
B. 24,1.
C. 24,4.
D. 24,9.
Câu 29: Chất X có công thức C4H14O3N2. Khi cho X tác dụng với dung dịch NaOH thì thu được hỗn hợp
Y gồm 2 khí ở điều kiện thường và đều có khả năng làm xanh quỳ tím ẩm. Số công thức cấu tạo phù hợp
của X là
A. 2.
B. 3.
C. 4.
D. 5.
Câu 30: Cho sơ đồ sau: NaCl → A → Na2CO3 → B → NaCl (với A, B là các hợp chất của natri). A và B
lần lượt là
A. NaOH và Na2O.
B. Na2SO4 và Na2O.
C. NaOH và NaNO3.
D. NaOH và Na2SO4.

Câu 31: Cho các chất sau: etilen, axetilen, isopren, toluen, propin, stiren, butan, cumen, benzen, buta-1,3đien. Phát biểu nào dưới đây đúng khi nhận xét về các chất trên?
A. Có 5 chất làm mất màu dung dịch KMnO4 ở nhiệt độ thường.
B. Có 6 chất tác dụng với H2 (có xúc tác thích hợp và đun nóng).
C. Có 6 chất làm mất màu dung dịch brom.
D. Có 3 chất tác dụng với dung dịch AgNO3/NH3, đun nóng.
Câu 32: Este X hai chức, mạch hở được tạo từ ancol hai chức và hai axit cacboxylic đơn chức. Đốt
cháy hoàn toàn m gam X cần dùng 6,72 lít khí O2 (đktc), thu được 0,5 mol hỗn hợp gồm CO2 và H2O.
Mặt khác, thủy phân hoàn toàn m gam X trong 200 ml dung dịch KOH 1M, đun nóng. Cô cạn dung
dịch sau phản ứng, thu được chất rắn khan có khối lượng là
A. 12,1.
B. 8,1.
C. 10,7.
D. 6,7.
Câu 33: Hòa tan hết 35,52 gam hỗn hợp X gồm FeCl2, Mg, Fe(NO3)2 và Al vào dung dịch chứa 0,816 mol
HCl thu được dung dịch Y và 3,2256 lít khí NO (dktc). Cho từ từ AgNO3 vào dung dịch Y đến khi phản
ứng hoàn toàn thì lượng AgNO3 tối đa là 1,176 mol, thu được 164,496 gam kết tủa; 0,896 lít khí NO2 là
sản phẩm khử duy nhất (đktc) và dung dịch Z chứa m gam chất tan đều là muối. Giá trị m gần nhất với
giá trị nào sau đây?
A. 88 gam.
B. 43 gam.
C. 86 gam.
D. 44 gam.
Câu 34: Cho X, Y là hai axit hữu cơ mạch hở (MX < MY); Z là ancol no; T là este hai chức mạch hở không
phân nhánh tạo bởi X, T, Z. Đun nóng 38,86 gam hỗn hợp E chứa X, Y, Z, T với 400 ml dung dịch NaOH
1M vừa đủ thu được ancol Z và hỗn hợp F chứa hai muối có số mol bằng nhau. Cho Z vào bình chứa Na
dư thấy bình tăng 19,24 gam và thu được 5,824 lít H2 ở đktc. Đốt hoàn toàn hỗn hợp F cần 15,68 lít O2
(đktc) thu được khí CO2, Na2CO3 và 7,2 gam H2O. Thành phần phần trăm khối lượng của T trong E gần
nhất với giá trị gần nhất với
A. 14.
B. 26.

C. 9.
D. 51.
Câu 35: Nhỏ từ từ đến dư dung dịch X gồm
Ba(OH)2 1M và NaOH 2M vào dung dịch Y gồm a
mol H2SO4 và b mol Al2(SO4)3. Sự phụ thuộc của
tổng số mol kết tủa thu được vào thể tích dung dịch
X nhỏ vào được biểu diễn theo đồ thị ở hình vẽ dưới
đây:
Tỉ lệ a : b là
A. 1 : 2.
C. 1 : 1.

B. 2 : 1.
D. 3 : 5.

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 3


Câu 36: Cho các sơ đồ phản ứng:
(1) (X) + HCl  (X1) + (X2) + H2O
(2) (X1) + NaOH  (X3) + (X4)
(3) (X1) + Cl2  (X5)
(4) (X3) + H2O + O2  (X6)
(5) (X2) + Ba(OH)2  (X7)
(6) (X7) + NaOH  (X8)  + (X9) + …
(7) (X8) + HCl  (X2) +…
(8) (X5) + (X9) + H2O  (X4) + …
Biết X2 là khí thải gây hiệu ứng nhà kính, X6 có màu đỏ nâu. Cho các phát biểu sau đây:

(a) Oxi hóa X1 bằng KMnO4 trong H2SO4 loãng thu được khí màu vàng lục.
(b) X5 vừa có tính oxi hóa, vừa có tính khử.
(c) X7 có tính lưỡng tính.
(d) X9 là hóa chất quan trọng trong công nghiệp thủy tinh, bột giặt, phẩm nhuộm, giấy, sợi....
Số phát biểu đúng là
A. 1.
B. 2.
C. 3.
D. 4.
Câu 37: Hỗn hợp X gồm đipeptit C5H10N2O3, este đa chức C4H6O4, este C5H11O2N. Cho X tác dụng vừa
đủ với 800 ml dung dịch NaOH 0,1M, cô cạn dung dịch sau phản ứng thu được m gam muối khan và hỗn
hợp khí Z gồm các chất hữu cơ. Cho Z tác dụng với Na dư, thấy thoát ra 0,02 mol khí H2. Nếu đốt cháy
hoàn toàn Z, thu được 1,76 gam CO2. Còn oxi hóa Z bằng CuO dư đun nóng, sản phẩm thu được cho vào
lượng dư dung dịch AgNO3/NH3 dư, khối lượng Ag tạo ra là 10,80 gam. Giá trị của m là
A. 7,45.
B. 7,17.
C. 7,67.
D. 6,99.
Câu 38: Cho hỗn hợp A gồm X, Y là hai este đều mạch hở, không phân nhánh và không chứa nhóm chức
khác (MX < MY). Khi đốt cháy X cũng như Y với lượng O2 vừa đủ thì số mol O2 đã phản ứng bằng số mol
CO2 thu được. Đun nóng 30,24 gam hỗn hợp A (số mol X gấp 1,5 lần số mol Y) cần dùng 400ml dung dịch
KOH 1M, thu được hỗn hợp B chứa 2 ancol và hỗn hợp D chứa 2 muối. Dẫn toàn bộ B qua bình đựng Na
dư thấy khối lượng bình tăng 15,2 gam. Đốt cháy hoàn toàn hỗn hợp D cần dùng 0,42 mol O2. Tổng số
nguyên tử có trong phân tử Y là
A. 20.
B. 21.
C. 19.
D. 22.
Câu 39: Hòa tan hết 20 gam hỗn hợp X gồm Cu và các oxit sắt (trong hỗn hợp X oxi chiếm 16,8% về khối
lượng) cần vừa đủ dung dịch hỗn hợp A chứa b mol HCl và 0,2 mol HNO3 thu được 1,344 lít NO (đktc) là

sản phẩm khử duy nhất và dung dịch Y. Cho dung dịch Y tác dụng với một lượng AgNO3 vừa đủ thu được
m gam kết tủa và dung dịch Z. Cho Z tác dụng với một lượng dư dung dịch NaOH, lọc kết tủa, nung đến
khối lượng không đổi thu được 22,4 gam chất rắn. Các phản ứng xảy ra hoàn toàn. Giá trị của m là
A. 76,81.
B. 78,97.
C. 83,29.
D. 70,33.
Câu 40: Chất X có công thức phân tử C6H8O4. Cho 1 mol X phản ứng hết với dung dịch NaOH, thu được
chất Y và 2 mol chất Z. Đun Z với dung dịch H2SO4 đặc, thu được đimetyl ete. Chất Y phản ứng với lượng
dư dung dịch H2SO4 loãng, thu được chất T. Cho T phản ứng với HBr, thu được hai sản phẩm là đồng phân
cấu tạo của nhau. Phát biểu nào sau đây đúng?
A. Chất Y có công thức phân tử C4H4O4Na2.
B. Chất T không có đồng phân hình học.
C. Chất X phản ứng với H2 (Ni, to) theo tỉ lệ mol 1 : 3.
D. Chất Z làm mất màu nước brom.

--------- HẾT ---------

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 4


ĐÁP ÁN ĐỀ THI THPT NGÔ GIA TỰ
1-B
11-B
21-A
31-C

2-C

12-C
22-A
32-A

3-B
13-B
23-A
33-A

4-D
14-A
24-D
34-D

5-D
15-C
25-A
35-B

6-A
16-C
26-C
36-D

7-C
17-B
27-D
37-A

8-D

18-D
28-A
38-B

9-D
19-C
29-B
39-B

10-C
20-B
30-D
40-B

HƯỚNG DẪN GIẢI CHI TIẾT
Câu 4: Chọn D.
Ta có: mC2H5OH 

12,15
m
.0, 7.2.46  4,83 (kg)  VC2H5OH   6, 035 (l) (drượu = 0,8 g/ml)
162
d

VC2H5OH
.100  V  15, 09 (l)
V
Câu 19: Chọn C.
Ban đầu hình thành kết CaCO3 làm giảm độ tan  độ sáng bóng đèn giảm
Sau đó kết tủa tan dần tạo dung dịch trong suốt  độ sáng bóng đèn tăng.

Câu 21: Chọn A.
m  61, 6  m

x  2y 

Ala : x mol 
 x  1, 2
22


 m  m Ala  mGlu  224, 4 (g)

Glu : y mol  x  y  m  73  m
 y  0,8

36,5

Câu 22: Chọn A.
Các đồng phân thoả mãn là: Ala-Val-Ala-Gly-Val; Val-Ala-Ala-Gly-Val; Ala-Gly-Val-Ala-Val;
Ala-Gly-Val-Val-Ala; Ala-Ala-Gly-Val-Val và Val-Ala-Gly-Val-Ala.
Câu 23: Chọn A.
22, 475  13,35
BTKL

 n HCl  n X 
 0, 25 mol . Gọi CTPT của X là CnH2n + 3N
36,5
D

 M X  14n  17 


CO : 0, 65mol
13,35
 n  2, 6 . Từ phản ứng đốt cháy   2
 m  47, 05 (g)
0, 25
H 2O :1, 025mol

Câu 24: Chọn D.
(2) Sai, Nhỏ vài giọt dung dịch HCl vào dung dịch anilin thấy anilin tan dần.
(3) Sai, Các este là chất lỏng hoặc rắn ở nhiệt độ thường và tan rất ít trong nước.
Câu 21. Chọn A.
Có 3 CTCT của X là HCOOC6H4OH (o, m, p).
Câu 26: Chọn C.
o

H 2SO4 , t
2ROH 
 ROR  H 2O

n ROH
.0,5  0,1mol  M ROR  77, 04  M R  30,52
2
n
Nếu hiệu suất là 40% thì: n ROR  ROH .0, 4  0, 08mol  M ROR  96,3  M R  40,15
2
 2 gốc R lần lượt là C2H5 (29) và C3H7 (43). Vậy 2 ancol đó là etanol và propan-1-ol.
Câu 27: Chọn D.
Chất tham gia phản ứng thủy phân là etyl axetat, vinyl fomat, tripanmitin, triolein, saccarozơ, tinh bột,
xenlulozơ.

Câu 28: Chọn B.
X có công thức cấu tạo là HCOO-CH2-COO-CH3
BTKL
 m Y  17, 7  0, 4.40  0,15.32  28,9 (g)
Khi cho X tác dụng với NaOH thì: 

Nếu hiệu suất là 50% thì: n ROR 

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 5


Câu 29: Chọn B.
Các chất ở trạng thái khí là NH3, CH3NH2, C2H5NH2, CH3NHCH3, (CH3)3N.
Số công thức cấu tạo của X là: NH4-CO3-NH(CH3)3; CH3NH3-CO3-NH2(CH3)2; CH3NH3-CO3-NH3C2H5.
Câu 30: Chọn D.
dpdd
 CO 2
 H 2SO 4
 BaCl 2
NaCl 
 NaOH 
 Na 2CO 3 

 Na 2SO 4 
 BaSO 4

Câu 31: Chọn C.
Chất làm mất màu

Chất tác dụng với H2:
Chất làm mất màu dung Chất tác dụng với dung
KMnO4: etilen,
etilen, axetilen, isopren, dịch Br2: etilen,
dịch AgNO3/NH3:
axetilen, isopren,
toluen, propin, stiren,
axetilen, isopren,
axetilen, propin.
propin, stiren, buta-1,3- cumen, benzen, butapropin, stiren, buta-1,3đien.
1,3-đien.
đien.
Câu 32: Chọn A.
Gọi CTTQ của este: CnH2n + 2 – 2kO4 (k = πgốc + πchức = πgốc + 2).
Sử dụng độ bất bão hoà, ta có: n CO2  n H2O  (k  1).n X (1)
Bảo toàn nguyên tố O: 4nX + 2.0,3 = 2n CO2  n H 2O (2)
Theo đề ta có: n CO2  n H 2O = 0,5 (3)
Ở đây có 3 phương trình mà có tới 4 ẩn nên chúng ta đi xét các giá trị của k:
+ Với k = 2 (πgốc = 0) thay vào (1), (2), (3)  không thoả mãn.
n CO2  0,3 mol
n CO2

+ Với k = 3 (πgốc = 1) thay vào (1), (2), (3)  n H2O  0, 2 mol  C X 
6
n
X

n X  0, 05 mol
 Công thức cấu tạo của X là CH2=CH-COO-CH2-CH2-OOC-H.
Chất rắn gồm KOH dư: 0,1 mol ; C2H3COOK: 0,05 mol và HCOOK: 0,05 mol  mrắn = 12,1 gam.

Câu 33: Chọn A.


AgCl
n AgCl  n Ag  1,176
n AgCl  1, 056 mol

Kết tủa gồm 
với 
Ag

143,5n AgCl  108n Ag  164, 496 
n Ag  0,12 mol
n AgCl  n HCl
BT: Cl

 n FeCl2 
 0,12 mol và n H  dư = 2n NO2  0,08 mol
2
Ta có: n H  4n NO  10n NH   0,816  0, 08  n NH   0, 016 mol
4

BT: N

 n Fe(NO3 )2 

4

n NO  n NH 


4
 0, 08 mol  m Al  m Mg  5,88
2
Dung dịch Z gồm Mg2+, Al3+, Fe3+ (0,2 mol), NH4+ (0,016 mol), NO3–.
BT: N

 n NO  (Z)  n AgNO3  n NO2  1,136 mol  mZ  87,8 gam

3

Câu 34: Chọn D.
Khi dẫn Z qua bình đựng Na dư thì: mancol = mb.tăng + m H 2 = 19,76 (g)
+ Giả sử anol Z có x nhóm chức khi đó: M Z 

mZ
x2
x  38x 
 M Z  76 : C3H 6 (OH) 2 (0, 26 mol)
2n H 2

 2F1 + 2F2 + C3H6(OH)2 + H2O
Khi cho hỗn hợp E: X + Y + T + Z + 4NaOH 
mol: x
y
t
z
0,4
+ Vì 2 muối có tỉ lệ mol 1 : 1 nên x = y
Khi đốt cháy hoàn toàn muối F thì: n Na 2CO3  0,5n NaOH  0, 2 mol
BT: O


 n CO2 

C F  2
2(n F1  n F2 )  2n O 2  3n Na 2CO3  n H 2O
 0, 6 mol  
2
H F  2

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 6


 Trong F có chứa muối HCOONa và muối còn lại là CH2=CHCOONa với số mol mỗi muối là 0,2 mol
 X, Y, Z, T lần lượt là HCOOH; CH2=CHCOOH; C3H6(OH)2; CH2=CHCOOC3H6OOCH.
n NaOH  2x  2t  0, 4
 x = 0,075


Ta có hệ sau: n C3H 6 (OH) 2  z  t  0, 26
 z  0,135  %m T  50,82%
m  46x  72x  76z  158t  38,86  t  0,125

 E
Câu 35: Chọn B.

n Ba(OH)2  0, 03mol
Tại V  0, 03(l)  
 n OH   n H   4n Al3  2a  8b  0,12


n NaOH  0, 06 mol

n Ba(OH)2  0, 05 mol
Tại V  0, 03(l)  
 n Ba 2  n SO 2  a  3b  0, 05
4

n NaOH  0,1 mol
Từ (1), (2) suy ra tỉ lệ a : b = 0,02 : 0,01 = 2 : 1.
Câu 36: Chọn D.
X là FeCO3; X1 là FeCl2; X2 là CO2; X3 là Fe(OH)2; X4 là NaCl; X5 là FeCl3; X6 là Fe(OH)3; X7 là
Ba(HCO3)2; X8 là BaCO3; X9 là Na2CO3.
(a) Đúng, Oxi hóa FeCl2 bằng KMnO4 trong H2SO4 loãng thu được khí màu vàng lục là Cl2.
(b) Đúng, FeCl3 (số oxi hoá của Fe và Cl là +3, -1)  vừa có tính oxi hóa, vừa có tính khử.
(c) Đúng, Ba(HCO3)2 có tính lưỡng tính.
(d) Đúng, Na2CO3 là hóa chất quan trọng trong công nghiệp thủy tinh, bột giặt, phẩm nhuộm, giấy, sợi....
Câu 37: Chọn A.
Xử lí hỗn hợp Z, nhận thấy: n C  n CO2  n OH  2n H2  Các chất trong Z có số nguyên tử C bằng với số

nhóm OH.

 x  2y  n CO2  0, 04  x  0, 01
CH3OH : x mol


Từ 2 este ban đầu  Z gồm 
 y  0, 015
C2 H 4  OH 2 : y mol 4x  4 y  n Ag  0,1
Khi cho X tác dụng với NaOH thì: n KOH  2nGlyAla  2.nC4H6O4  nC5H11O2 N  nGlyAla  0,02mol

Gly  Ala : 0, 02 mol
AlaNa  GlyNa


 m = 7,45 gam
X (HC OO)2 C2 H 4 : 0, 015 mol  hỗn hợp rắn HC OONa
H NC H COONa
H NC H COOCH : 0, 01 mol
 2 3 6
3
 2 3 6
Câu 38: Chọn B.
1
Ta có: n H 2  n KOH  0, 2 mol  mancol  mb.tăng + 2n H 2 = 15,6 (g)
2
 M C 2H 5OH 
m
 M
 M F  ancol  39   CH 3OH
 : 2 ancol đó là CH3OH (0,2 mol) và C 2H5OH (0,2 mol).
2n H 2
2



Khi đốt cháy E thì: n CO2  n O2  n CO2 (K)  n CO2 (F)  n K 2CO3  n CO2 (K)  0,8
m E  32n O 2  44n CO 2 20, 64  12n CO 2 (K)

18
18

Khi cho E tác dụng với KOH thì: mK  mE  56n KOH  mancol  37,04 (g)
6, 24  12n CO 2 (K)
6, 24  12n CO 2 (K)
BT: H
 n H(K)  2n H 2O  n KOH  n H(F) 
 n H 2 O(K) 
(1)
9
18
Khi đốt cháy K thì: m F  32n O2  44n CO2 (K)  18n H 2O(K)  138n K 2CO3  n CO 2 (K)  0,52 mol
BTKL

 n H 2O 

Thay n CO 2 vào (1) nhận thấy n H 2O(K)  0  trong muối K không chứa H.

C x (COOK) 2 :1,5a
x  0
BT: C
 3a  2a = 0,4  a = 0,08  0,12x  0, 08y  0,32  
Gọi muối K 
y  4
C y (COOK) 2 : a

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 7


X : H 3COOC  COOC 2 H 5

mà n CH 3OH  n C2H5OH  n (COOK) 2  n C4 (COOK) 2  
Y : H 3COOC  C  C  C  C  COOC 2H 5
Vậy tổng số nguyên tử nguyên tố có trong Y là 21.
Câu 39: Chọn B.
Quy hỗn hợp thành Fe, Cu, O (0,21 mol)
Dung dịch Y gồm Cu2+ (x mol), Fe2+ (y mol), Fe3+ (z mol); Cl- (b mol), NO3-.
Hỗn hợp rắn gồm CuO: x mol và Fe2O3: 0,5.(y + z) mol
64x  56.(y  z)  20  0, 21.16
 x  0,12


Ta có: 80x  160.0,5.(y  z)  22, 4
  y  0,12
 BT: e

 2x  2y  3z  0, 06.3  0, 21.2 z  0, 04
 
BT: N

 0, 2  n NO3  0, 06  n NO3  0,14 mol . Áp dụng BTĐT trong (Y)  b = 0,46 mol

Kết tủa thu được gồm Ag (0,12 mol) và AgCl (0,46 mol)  mkết tủa = 78,97 (g)
Câu 40: Chọn D.
Dựa vào các dữ kiện của đề bài ta xác định được các chất X, Y, Z, T tương ứng là:
0

t
CH 2  C(COOCH3 ) 2 (X)  2NaOH 
 CH 2  C(COONa) 2 (Y)  2CH 3OH (Z)
0


H 2SO4 ,140 C
2CH3OH (Z) 
 CH3OCH3  H 2O

CH 2  C(COONa) 2 (Y)  H 2SO 4 
 CH 2  C(COOH) 2 (T)  Na 2SO 4

2CH 2  C(COOH) 2 (T)  2HBr 
 CH 3CHBr(COOH) 2  CH 2 Br  CH  (COOH) 2
A. Sai, Chất Y có công thức phân tử C4H2O4Na2.
C. Sai, Chất X phản ứng với H2 (Ni, to) theo tỉ lệ mol 1 : 2.
D. Sai, Chất Z không làm mất màu nước brom.

--------------HẾT---------------

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 8


SỞ GIÁO DỤC VÀ ĐÀO TẠO
BẮC GIANG

ĐỀ KHẢO SÁT THÁNG 11
THPT CHUYÊN BẮC GIANG
Bài thi: KHOA HỌC TỰ NHIÊN
Môn thi thành phần: HOÁ HỌC
Thời gian làm bài: 50 phút, không kể thời gian phát đề


ĐỀ CHÍNH THỨC
(Đề có 04 trang)
Họ, tên thí sinh: .....................................................................
Mã đề thi 108
Số báo danh: ..........................................................................
* Cho biết nguyên tử khối của các nguyên tố:
H = 1; He = 4; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; S = 32; Cl = 35,5; K = 39; Ca = 40; Cr
= 52; Mn = 55; Fe = 56; Cu = 64; Zn = 65; Br = 80; Ag = 108; Ba = 137.
* Các thể tích khí đều đo ở điều kiện tiêu chuẩn, giả thiết các khí sinh ra không tan trong nước.
Câu 1. Trong các dây sau, dãy gồm các chất tác dụng được với dung dịch HCl là
A. Fe(OH)3, Na2CO3, AgNO3.
B. Mg(OH)2, BaSO4, CaCO3.
C. Cu, NaOH, AgNO3.
D. MnO2, CuO, H2O.
Câu 2. Ở ruột non của cơ thể người nhờ tác dụng xúc tác của các enzim như lipaza và dịch mật, chất béo
bị thủy phân thành:
A. NH3, CO2 và H2O
B. CO2 và H2O
C. axit béo và glixerol
D. axit cacboxylic và glixerol
Câu 3. Cho 0,1 mol amino axit X tác dụng vừa đủ với 100 ml dung dịch NaOH 1M, sau phản ứng thu được
dung dịch chứa 11,1 gam muối. Số nguyên tử hiđro trong phân tử X là
A. 7.
B. 11.
C. 9.
D. 8.
Câu 4. Dung dịch X gồm 0,02 mol Cu(NO3)2 và 0,1 mol H2SO4. Khối lượng Fe tối đa phản ứng được với
dung dịch X là (biết NO là sản phẩm khử duy nhất của NO).
A. 4,48 gam.
B. 5,60 gam.

C. 3,36 gam.
D. 2,24 gam.
Câu 5. Thủy phân hoàn toàn 3,42 gam saccarozơ trong môi trường axit, thu được dung dịch X. Cho toàn
bộ dung dịch X phản ứng hết với lượng dư dung dịch AgNO3 trong NH3, đun nóng, thu được m gam Ag.
Giá trị của m là
A. 2,16 gam.
B. 43,20 gam.
C. 4,32 gam.
D. 21,60 gam.
Câu 6. Kim loại nào sau đây được điều chế bằng phương pháp nhiệt luyện?
A. Al.
B. Ca. .
C. Na.
D. Fe.
Câu 7. Cho các dung dịch sau: HCl, Na2CO3, AgNO3, Na2SO4, NaOH và KHSO4. Số dung dịch tác dụng
được với dung dịch Fe(NO3)2 là
A. 6.
B. 3.
C. 4.
D. 5.
Câu 8. Cho các chất : Al, AlCl3, Zn(OH)2, NH4HCO3, KHSO4, NaHS, Fe(NO3)2. Số chất vừa phản ứng với
dung dịch NaOH vừa phản ứng với dung dịch HCl là
A. 4.
B. 6.
C. 5.
D. 3.
Câu 9. Có 5 dung dịch NH3, HCl, NH4Cl, Na2CO3, CHCOOH cùng nồng độ được đánh ngẫu nhiên là A,
B, C, D, E. Giá trị pH và khả năng dẫn điện của dung dịch theo bảng sau:
Dung dịch
A

B
C
D
E
pH
5,250
11,53
3,010
1,250
11,00
Khả năng dẫn điện
Tốt
Tốt
Kém
Tốt
Kém
Các dung dịch A, B, C, D, E lần lượt là
A. CH3COOH, NH3, NH4Cl, HCl, Na2CO3.
B. NH4Cl, Na2CO3, CH3COOH, HCl, NH3.
C. Na2CO3, HCl, NH3, NH4Cl, CH3COOH
D. NH4Cl, NH3, CH3COOH, HCl, Na2CO3.
Câu 10. Dung dịch chất nào sau đây không làm quì tím đổi màu?
A. Glyxin.
B. CH3NH2
C. CH3COONa.
D. HCOOH

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 9



Câu 11. Cho các phản ứng sau:
AgNO3 + Fe(NO3)2 
 Ag + Fe(NO3)3
Cu + Fe(NO3)3 
 Cu(NO3)2 + Fe(NO3)2
Fe + Cu(NO3)2 
 Fe(NO3)2 + Cu
Dãy được sắp xếp theo chiều tăng dần tính khử là
A. Ag, Cu, Fe2+, Fe
B. Ag, Fe2+, Cu, Fe.
C. Fe2+, Cu, Ag, Fe.
D. Fe2+, Ag, Cu, Fe.
Câu 12. Đốt cháy hoàn toàn m gam hỗn hợp 3 ancol đơn chức, thuộc cùng dãy đồng đẳng, thu được 3,808
lít khí CO2 (đktc) và 5,4 gam H2O. Giá trị của m là
A. 5,72
B. 5,42
C. 4,72.
D. 7,42.
Câu 13. Trong dãy các kim loại: Al, Cu, Au, Fe. Kim loại có tính dẻo lớn nhất là
A. Al.
B. Fe.
C. Au.
D. Cu.
Câu 14. Phát biểu nào sau đây biểu là đúng?
A. Chất béo là este của glixerol với axit cacboxylic.
B. Amino axit là loại hợp chất hữu cơ đa chức.
C. Các amin đều có khả năng làm hồng dung dịch phenolphtalein.
D. Poliacrilonitrin và policaproamit là vật liệu polime hình sợi dài và mảnh với độ bền nhất định.

Câu 15. Chất nào sau đây thuộc loại monosaccarit?
A. Glucozơ.
B. Tinh bột.
C. Xenlulozơ.
D. Saccarozo.
Câu 16. Không thể dùng dung dịch (trong nước) nào sau đây để phân biệt CO2 và SO2?
A. Ba(OH)2.
B. brom.
C. KMnO4
D. H2S
Câu 17. Tiến hành các thí nghiệm sau:
(a) Nhúng thanh đồng nguyên chất vào dung dịch FeCl3.
(b) Đề miếng tôn (sắt tráng kẽm) trong không khí ẩm
(c) Nhúng thanh kẽm vào dung dịch H2SO4 loãng có nhỏ vài giọt dung dịch CuSO4.
(d) Đốt sợi dây sắt trong bình đựng khí oxi.
Trong các thí nghiệm trên, số thí nghiệm xảy ra ăn mòn điện hoá là
A. 2.
B. 3.
C. 1
D. 4.
Câu 18. Công thức cấu tạo thu gọn của metyl axetat là
A. CH3COOCH3.
B. HCOOCH3.
C. CH3COOC2H3.
D. CH3COOC2H5.
Câu 19. Kim loại được dùng phổ biến để tạo trang sức, có tác dụng bảo vệ sức khỏe là
A. Sắt tây.
B. Sắt.
C. Đồng.
D. Bạc.

Câu 20. Cho 13,8 gam chất hữu cơ X có CTPT C7H8 tác dụng với một lượng dư dung dịch AgNO3 trong
NH3 thu được 45,9 gam kết tủa. X có bao nhiêu đồng phận cấu tạo thõa mãn tính chất trên?
A. 5.
B. 6.
C. 3.
D. 4.
Câu 21. Phân tử khối của axit glutamic là
A. 89.
B. 117.
C. 146.
D. 147.
Câu 22. Hỗn hợp X gồm Fe2O3, CuO và Al2O3. Để hòa tan vừa đủ 29,1 gam hỗn hợp X cần 2,2 lít dung
dịch HCl 0,5M. Lấy 14,55 gam hỗn hợp X cho tác dụng hoàn toàn với H2 dư (nung nóng) thu được 3,6 gam
H2O. Phần trăm khối lượng Fe2O3 trong X là
A. 42,09%.
B. 57,10%.
C. 54,98%.
D. 55,00%.
Câu 23. Để oxi hóa hoàn toàn 0,01 mol CrCl3 thành K2CrO4 trong môi trường kiềm cần dùng số mol Cl2
là?
A. 0,01 mol.
B. 0,015 mol.
C. 0,025 mol
D. 0,03.
Câu 24. Một số este có mùi thơm, không độc, được dùng làm chất tạo mùi hương trong công nghiệp thực
phâm, mỹ phẩm. Benzyl axetat có mùi thơm của loại hoa (quả) nào sau đây?
A. Hoa nhài.
B. Dứa chín.
C. Chuối chín.
D. Hoa hồng.

Câu 25. Hợp chất hữu cơ nào sau đây hòa tan được Cu(OH)2 tạo phức màu tím?
A. Saccarozơ.
B. Glyxylglyxin.
C. Glucozơ.
D. Alanylalanylalanin.

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 10


Câu 26. Xây hầm bioga là cách xử lí phân và chất thải gia xúc đang được tiến hành. Quá trình này không
những làm sạch nơi ở và vệ sinh môi trường mà còn cung cấp một lượng lớn khí ga sử dụng cho việc đun,
nấu. Vậy thành phần chính của khí bioga là:
A. etan.
B. propan.
C. butan.
D. metan.
Câu 27. Cho m gam X gồm Na, Na2O, Al, Al2O3 vào nước dư thấy tan hoàn toàn, thu được dung dịch Y
chứa một chất tan và thấy thoát ra 4,48 lít khí H2 (đktc). Sục khí CO2 dư vào dung dịch Y, thu được 15,6
gam chất rắn. Giá trị của m là
A. 11.2 gam.
B. 12,2 gam.
C. 13,2 gam.
D. 14,2 gam.
Câu 28. Trong phòng thí nghiệm, bộ dụng cụ vẽ dưới đây:

Thí nghiệm trên có thể dùng điều chế bao nhiêu khí trong số các khí sau: Cl2, NH3, SO2, CO2, H2, C2H4
(các điều kiện phản ứng có đủ).
A. 5.

B. 3.
C. 2.
D. 4.
Câu 29. Tiến hành các thí nghiệm sau:
(a) Sục SO2 vào dung dịch KMnO4 loãng.
(b) Cho hơi ancol etytic đã qua bột CuO nung nóng.
(c) Sục khí etilen vào dung dịch Br2 trong CCl4.
(d) Cho Fe2O3 vào dung dịch H2SO4 đặc nóng.
(e) Cho Fe2O3 vào dung dịch HI.
(g) Nhiệt phân KHCO3.
Trong các thí nghiệm trên, số thí nghiệm có xảy ra phản ứng oxi hóa - khử là
A. 2.
B. 5.
C. 3..
D. 4.
Câu 30. Nung 61,32 gam hỗn hợp rắn gồm Al và các oxit sắt trong khí trơ ở nhiệt độ cao đến khi phản ứng
xảy ra hoàn toàn thu được hỗn hợp X. Chia X thành 2 phần bằng nhau.
- Phần một cho tác dụng với dung dịch NaOH dư thu được 2,016 lít khí (đktc).
- Phần hài hòa tan hết trong dung dịch chứa 1,74 mol HNO3 thu được dung dịch Y chỉ chứa các muối và
4,032 lít NO (đktc) thoát ra. Cô cạn dung dịch Y, lấy rắn thu được đem nung ngoài không khí đển khối
lượng không đổi thu được hai chất rắn có số mol bằng nhau. Nếu cho Y tác dụng với dung dịch Na2CO3 dư
thì thu được a gam kết tủa. Giá trị của a là
A. 57,93.
B. 50,91.
C. 58,20.
D. 50,40.
Câu 31. Cho các tờ sau đây: tơ lapsan, tơ enang, tơ visco, tơ olon, tơ tằm, tơ nilon-6,6. Biết rằng có:
(1) x loại tơ có nhóm amit.
(2) y loại tơ hóa học.
(3) z loại tơ mà trong thành phần cấu tạo có vòng benzen.

(4) t loại tơ được điều chế bằng phản ứng trùng ngưng các monome tương ứng.
Giá trị của tổng x + y + z + t là
A. 13.
B. 14.
C. 12.
D. 11.
Câu 32. Hòa tan hoàn toàn hai chất rắn X, Y (có số nối bằng nhau) vào nước thu được dung dịch Z. Tiến
hành các thí nghiệm sau:
Thí nghiệm 1: Cho dung dịch NaOH dư vào V ml dung dịch Z, thu được a mol kết tủa.
Thí nghiệm 2: Cho dung dịch NH3 dư vào V ml dung dịch Z, thu được b mol kết tủa.
Thí nghiệm 3: Cho dung dịch AgNO3 dư vào V ml dung dịch Z, thu được c mol kết tủa.
Biết các phản ứng xảy ra hoàn toàn và a < b < c. Hai chất X, Y lần lượt là
A. CuCl2, FeCl2.
B. FeCl2, FeCl3.
C. CuCl2, FeCl3.
D. FeCl3, AICl3.

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 11


Câu 33. Điện phân 500 ml dung dịch X gồm CuSO4 và NaCl với điện cực trơ, màng ngăn xốp bằng dòng
điện một chiều có cường độ I = 10A. Sau 19 phút 18 giây thì ngừng điện phân, thu được dung dịch Y có
khối lượng giảm 6,78 gam so với lượng dung dịch X đem điện phân. Sục từ từ khí H2S vào dung dịch Y
đến khi lượng kết tủa tạo ra lớn nhất thì ngừng sục khí, thu được 500 ml dung dịch Z có pH = 1,0. Nồng độ
mol NaCl trong dung dịch X có giá trị gần nhất là
A. 0,15.
B. 0,16..
C. 0,17.

D. 0,18.
Câu 34. Cho các phát biểu sau:
(1) Axit axetic có nhiệt độ sôi cao hơn ancol etylic.
(2) Vinyl axetat có khả năng làm mất màu nước brom.
(3) Tinh bột khi thủy phân hoàn toàn trong môi trường kiềm chỉ tạo glucozơ.
(4) Dung dịch anbumin của lòng trắng trứng khi đun sôi bị đông tụ.
(5) Tơ nilon bền đối với nhiệt, axit, kiềm hơn tơ lapsan.
(6) Anilin ở điều kiện thường là chất lỏng, không màu, độc, ít tan trong nước và nhẹ hơn nước.
Số phát biểu đúng là
A. 1.
B. 3.
C. 4.
D. 2.
Câu 35. Hòa tan hết hỗn hợp X gồm Mg, Fe trong 800 ml dung dịch HNO3 1M thu được dung dịch Y chỉ
chứa 52 gam muối và 1,12 lít (đktc) hỗn hợp khí X gồm N2 và N2O có tỉ khối hơi so với H2 bằng 18. Cho
Y tác dụng với một lượng dư dung dịch NaOH thu được m gam kết tủa. Biết các phản ứng xảy ra hoàn
toàn. Giá trị của m gần nhất với giá trị nào sau đây?
A. 22,5.
B. 18,2.
C. 20,8.
D. 16,5.
Câu 36. Đốt cháy hoàn toàn 0,06 mol hỗn hợp X gồm ba chất béo cần dùng 4,77 mol O2, thu được 56,52
gam nước. Mặt khác hiđro hóa hoàn toàn 78,9 gam X trên bằng lượng H2 vừa đủ (xúc tác Ni, to), lấy sản
phẩm tác dụng với dung dịch KOH vừa đủ, thu được x gam muối. Giá trị của x là.
A. 86,10 gam.
B. 85,92 gam.
C. 81,78 gam.
D. 81,42 gam.
Câu 37. Cho các bước ở thí nghiệm sau:
- Bước 1: Nhỏ vài giọt anilin vào ống nghiệm chứa 10 ml nước cất, lắc đều, sau đó để yên.

- Bước 2: Nhỏ tiếp dung dịch HCl đặc vào ống nghiệm.
- Bước 3: Cho tiếp dung dịch NaOH loãng (dùng dư), đun nóng.
Cho các phát biểu sau:
(1) Kết thúc bước 1, nhúng quỳ tím vào thấy quỳ tím không đổi màu.
(2) Ở bước 2 thì anilin tan dần.
(3) Kết thúc bước 3, thu được dung dịch trong suốt.
(4) Ở bước 1, anilin hầu như không tan, nó tạo vẩn đục và lắng xuống đáy.
(5) Sau khi làm thí nghiệm, rửa ống nghiệm bằng dung dịch HCl, sau đó tráng lại bằng nước sạch.
Số phát biểu đúng là
A. 1.
B. 4.
C. 3.
D. 2.
Câu 38. Hỗn hợp X gồm metyl fomat, đimetyl oxalat, glixeryl triaxetat và phenyl fomat. Thủy phân hoàn
toàn 47,3 gam X trong NaOH dư, đun nóng, thu được m gam hỗn hợp muối và 15,6 gam hỗn hợp Y gồm
các ancol. Cho 15,6 gam Y tác dụng với Na (dư) thu được 5,6 lít khí H2 (đkc). Mặt khác đốt cháy hoàn toàn
47,3 gam X bằng oxi, thu được 92,4 gam CO2 và 26,1 gam H2O. giá trị của m là
A. 54,3.
B. 57,9.
C. 52,5.
D. 58,2.
Câu 39. Hỗn hợp X gồm hai chất béo được tạo bởi từ axit oleic và axit stearic. Hỗn hợp Y gồm hai peptit
mạch hở có cùng số nguyên tử cacbon. Đun nóng 104 gam hỗn hợp X chứa X và Y với dung dịch NaOH
vừa đủ, thu được 119,8 gam hỗn hợp Y chứa các muối (trong đó có ba muối của glyxin, alanin và valin).
Đốt cháy toàn bộ T, thu được CO2, N2; 5,33 mol H2O và 0,33 mol Na2CO3. Nếu đốt cháy hoàn toàn 104
gam Z trên, thu được CO, N2 và 5,5 mol H2O. Phần trăm khối lượng muối của glyxin trong hỗn hợp T là
A. 16,19%.
B. 19,43%.
C. 21,05%.
D. 14,57%.

Câu 40. Hỗn hợp X chứa hai hợp chất hữu cơ đều mạch hở gồm chất Y (C4H14O3N2) và chất Z (C3H7O4N)
tác dụng với một lượng dung dịch NaOH vừa đủ, đun nóng đến khi phản ứng xảy ra hoàn toàn. Cô cạn
dung dịch thu được hỗn hợp gồm hai muối, trong đó có một muối của axit hữu cơ và 4,48 lít (đktc) hỗn hợp

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 12


gồm hai amin đơn chức, kế tiếp trong dãy đồng đẳng có tỉ khối so với He là 8,45. Phần trăm khối lượng
của Y trong X là
A. 30,07%.
B. 27,54%.
C. 72,16%.
D. 74,23%.
--------------HẾT---------------

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 13


ĐÁP ÁN ĐỀ THI THPT CHUYÊN BẮC GIANG
1. A
11. B
21. D
31. C

2. C
12. C

22. C
32. D

3. A
13. C
23. B
33. A

4. B
14. D
24. A
34. C

5. C
15. A
25. D
35. C

6. D
16. A
26. D
36. A

7. D
17. A
27. C
37. B

8. C
18. A

28. B
38. B

9. B
19. D
29. D
39. B

10. A
20. D
30. C
40. B

HƯỚNG DẪN GIẢI CHI TIẾT
Câu 4. Chọn B.
Sự oxi hóa
Fe → Fe + 2e
(vì lượng Fe phản ứng tối đa nên Fe chuyển
lên Fe2+).
2+

Sự khử
4H + NO3 + 3e
→ NO + 2H2O
0,16 ← 0,04 → 0,12 → 0,04
Cu2+ + 2e → Cu
0,02 → 0,04
2H+(dư) + 2e → H2
0,04
→ 0,04 → 0,02

+

-

3n NO  2n Cu 2  2n H 2
 0,1 mol  m Fe  5, 6 (g)
2
Câu 7. Chọn D.
Dung dịch tác dụng được với dung dịch Fe(NO3)2 là HCl, Na2CO3, AgNO3, NaOH và KHSO4.
Câu 8. Chọn C.
Chất vừa phản ứng với NaOH vừa phản ứng với HCl là Al, Zn(OH)2, NH4HCO3, NaHS, Fe(NO3)2.
Câu 17. Chọn A.
Thí nghiệm xảy ra ăn mòn điện hoá là (b), (c).
Câu 20. Chọn D.
X là C7H8 có k = 4  X phản ứng với AgNO3 theo tỉ lệ 1 : 2 (tức là có 2 liên kết ba đầu mạch)
CH≡C-(CH2)2-C≡CH; CH≡C-CH(CH3)CH2-C≡CH; CH≡C-C(CH3)2-C≡CH; CH≡C-C(C2H5)-C≡CH
Câu 22. Chọn C.
Fe2 O3 : x mol 160x  80y  102z  29,1


(29,1g gấp 2 lần 14,55g)  x = 0,1  %mFe2O3  54,98%
CuO : y mol  6x  2y  6z  1,1
Al O : z mol
3x  y  n
H 2O  0, 4
 2 3

BT:e

 n Fe 


Câu 27. Chọn C.
Quy hỗn hợp thành Na, Al và O.
Một chất tan duy nhất là NaAlO2. Sục CO2 vào Y thu được Al(OH)3: 0,2 mol
BT: e
 n Na  3n Al  2n O  2n H2  n O  0, 2 mol
 nNa = nAl = 0,2 mol 
Vậy m = mNa + mAl + mO = 13,2 (g)
Câu 28. Chọn B.
Chất khí thoả mãn thí nghiệm trên là Cl2, SO2, CO2.
Điều chế Cl2 từ phản ứng giữa MnO2 và HCl đặc.
Điều chế SO2 từ phản ứng giữa Na2SO3 và H2SO4 đặc.
Điều chế CO2 từ phản ứng giữa CaCO3 và HCl.
Câu 29. Chọn D.
(a) 5SO2 + 2KMnO4 + 2H2O  2H2SO4 + K2SO4 + 2MnSO4
t
(b) C2H5OH + CuO 
 CH3CHO + Cu + H2O
(c) C2H4 + Br2  C2H4Br2
(d) Fe2O3 + 3H2SO4  Fe2(SO4)3 + 3H2O
(e) Fe2O3 + 6HI  2FeI2 + 3H2O + I2
t
(g) 2KHCO3 
 K2CO3 + CO2 + H2O
Số ra phản ứng oxi hóa - khử là (a), (b), (c), (e).

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 14



Câu 30. Chọn C.
2
n H  0, 06 mol
3 2
Hỗn hợp rắn X gồm Al dư, Al2O3 (x mol), Fe (y mol)  27.0,06 + 102x + 56y = 30,66 (1)
Phần hai: Chất rắn thu được gồm Fe2O3, Al2O3 có mol bằng nhau  0,5y = 0,06.0,5 + x (2)
Từ (1), (2) suy ra: x = 0,12 ; y = 0,3.
Có 2 trường hợp của Y xảy ra là muối Al3+, Fe2+ hoặc Al3+, Fe3+.
Khi cho Y tác dụng với Na2CO3 thu được:
+ TH1: Fe(OH)3: 0,3 mol; Al(OH)3: 0,06 + 0,12.2 = 0,3 mol  a = 55,5 (g) (khơng thoả mãn)
+ TH2: FeCO3: 0,3 mol; Al(OH)3: 0,06 + 0,12.2 = 0,3 mol  a = 58,2 (g) (thoả mãn)
Lưu ý: Bài này có NH4NO3, muốn tìm chính xác muối Fe2+, hay Fe3+ thì dùng BTNT và BTĐT.
Câu 31. Chọn C.
(1) Tơ amit: tơ enang, tơ tằm, tơ nilon-6,6 ⇒ x = 3.
(2) Tơ hố học: tơ lapsan, tơ enang, tơ visco, tơ olon, tơ nilon-6,6 ⇒ y = 5.
(3) Tơ mà trong thành phần cấu tạo có vòng benzen: tơ lapsan ⇒ z = 1.
(4) Tơ được điều chế bằng phản ứng trùng ngưng: tơ lapsan, tơ enang, tơ nilon-6,6 ⇒ t = 3.
Vậy x + y + z + t = 12
Câu 32. Chọn D.
Vì CuCl2 tạo phức với dung dịch NH3 nên a > b  loại câu A, B.
Nếu đáp án là câu C thì a = b  Chỉ có D thoả mãn.
Câu 33. Chọn A.
Cho H 2 S vào dung dòch Y thu được kết tủa  Y còn chứa CuSO 4

Phần một: Ta có nAl dư =

10.1158
 0,12
96500

Nếu H2O chưa bò điện phân ở catot  m giảm  0,06.64  0,06.71  8,1 > 6,78  H 2 O đã điện phân

19 phút 18 giây = 1158(s) 
 ne 

Anot Cu: 0,06 mol

m
 64.0,06  71x  32y  6,78 x  0,036
Cl2 : x mol   dd giảm

BT: e
Catot 
 2x  4y  0,12
y  0,012
 
O2 :y mol
BT: Cl

 nNaCl  2nCl  0,072 mol  CM NaCl  0,144M
2

Câu 34. Chọn B.
(3) Sai, Tinh bột khi thủy phân hồn tồn trong mơi trường axit tạo glucozơ.
(5) Sai, Tơ nilon kém bền đối với nhiệt, axit, kiềm.
(6) Sai, Anilin ở điều kiện thường là chất lỏng, khơng màu, độc, ít tan trong nước và nặng nhẹ hơn nước.
Câu 35. Chọn C.
Trong hỗn hợp khí X gồm N2 (0,025 mol) và N2O (0,025 mol)
Ta có: n HNO3  12n N2  10n N2O  10n NH4 NO3  n NH4NO3  0,025 mol
Xét trong dung dịch Y chứa Fen+, Mg2+, NH4+, NO3- có m KL  n NH   m NO   52 (1)

4

3

 n HNO3  n NH   n NO   2(n N2  n N2O )  n NO   0,675 mol . Từ (1)  mKL = 9,7 (g)
BT: N

4

3

3

Khi cho tác dụng với NaOH thì: n OH  n NO3   n NH   0,65 mol  m  mKL  mOH  20,75 (g)
4

BTDT (Y)

Câu 36. Chọn A.
Khi đốt cháy X thì:
6.n X  2n O2  n H 2O
BT:O
BTKL

 n CO2 
 3,38 mol 
 m X  m CO2  m H 2O  m O2  52, 6 (g)
2

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/


TYHH | Page 15


Theo độ bất bão hoà: (k  3 1).n X  n CO2  n H2O  0, 24  k  2
Với mX = 52,6 (g) thì nX = 0,06 mol  với mX = 78,9 (g) thì nX = 0,09 mol
Khi thủy phân: Y + 3KOH  muối + C3H5(OH)3
 n X  n C3H5 (OH)3  0,09 mol; n KOH  0, 27 mol
BTKL: mmuối  mX  mKOH  mC3H5 (OH)3  86,1(g)
Câu 37. Chọn B.
- Cho nước cất vào anilin lắc đều sau đó để yên một chút sẽ thấy tách làm 2 lớp nước ở trên, anilin ở dưới
(do anilin nặng hơn nước và rất ít tan trong nước trong nước).
- Cho HCl vào thu được dung dịch đồng nhất (do anilin tan được trong HCl, tạo muối tan)
C6H5NH2 + HCl  C6H5NH3Cl
- Cho NaOH vào dung dịch thu được vẫn đục, lại chia làm 2 lớp, lớp dưới là do anilin tạo ra, lớp trên là
dung dịch nước muối ăn.
C6H5NH3Cl + NaOH  C6H5NH2 + NaCl + H2O
Các phát biểu đúng là (1), (2), (4), (5).
Câu 38. Chọn B.
Các chất trong X lần lượt là: H-COO-CH3; HCOO-C6H5; (COOCH3)2; (CH3COO)3C3H5
Tổng quát:
-COO- + NaOH  -COONa + -OH
-COOC6H5 + 2NaOH  -COONa + C6H5ONa + H2O
nancol = 2.n H = 0,5 mol  neste = 0,5 mol
2

Xét phản ứng đốt cháy: m  mC  m H  mO  12n CO2  2n H 2O  16n O  n O  1, 2 mol
mà 2neste + 2neste phenol = 1,2  neste phenol = 0,1 mol
Ta có: nNaOH = 0,5 + 0,1.2 = 0,7 mol và n H2O  0,1 mol
BTKL


 mmuối= mX + mNaOH – mancol – mH2O = 57,9 (g)

Câu 39. Chọn B.
Quy T thành: C2 H4 NO2 Na (x mol),C17 H35COONa (y mol), H 2 ( z mol),CH 2 (t mol)
BTNT.Na
 
 x  y  0,33.2

 x  0, 42
35
BTNT.H
 
 2x  y  z  t  5,33
 y  0, 24


2


mT  97x  306y  2z  14t  119,8
z  0,13
 BTKL
y
0, 66
y   t  0, 42

 5,33  4.  
 104  40.0, 66  119,8  92.  18.  5,5 
3

2
3


Đặt số mol các muối GlyNa : a mol,AlaNa : b mol,ValNa : c mol

BTKL
BTNT.C

 n Y  n H2O  0,18(mol) 
 Cpeptit 

(Gly)2 Ala : b
2.0, 42  0, 42
7
0,18
(Gly)1 Val) : c

n C2H3NO  a  b  c  0, 42
a  0, 24

 BTNT.C

  
 2a  3b  5c  2.0, 42  0, 42  b  0, 06  %mGlyNa  19, 43%
n  b  c  0,18
c  0,12
Y




Câu 40. Chọn B.
CH5 N : a(mol)
a  b  0, 2
a  0,16


Ta có: Ma min  4.8, 45  33,8  
C2 H7 N : b(mol) 31a  45b  33,8.0, 2 b  0,04
 Y là CH3NH3-CO3-NH3C2H5: 0,04 (mol) và Z là HOOC-COOH3NCH3: 0,16 - 0,04 = 0,12 (mol)

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 16


 %m Y 

138.0, 04
 27,54%
138.0, 04  121.0,12
--------------HẾT---------------

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 17


SỞ GIÁO DỤC VÀ ĐÀO TẠO
TP. HỒ CHÍ MINH


ĐỀ KHẢO SÁT CHẤT LƯỢNG THÁNG 11
THCS – THPT NGUYỄN KHUYẾN
Bài thi: KHOA HỌC TỰ NHIÊN
Môn thi thành phần: HOÁ HỌC
Thời gian làm bài: 50 phút, không kể thời gian phát đề

ĐỀ CHÍNH THỨC
(Đề có 04 trang)
Họ, tên thí sinh: .....................................................................
Mã đề thi 109
Số báo danh: ..........................................................................
* Cho biết nguyên tử khối của các nguyên tố:
H = 1; He = 4; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; S = 32; Cl = 35,5; K = 39; Ca = 40; Cr
= 52; Mn = 55; Fe = 56; Cu = 64; Zn = 65; Br = 80; Ag = 108; Ba = 137.
* Các thể tích khí đều đo ở điều kiện tiêu chuẩn, giả thiết các khí sinh ra không tan trong nước.
Câu 1. Số đồng phân amin ứng với công thức C2H7N là
A. 1.
B. 2.
C. 3.
D. 4.
Câu 2. Công thức phân tử của axit stearic là
A. C17H35O2.
B. C17H36O2.
C. C18H36O2.
D. C18H34O2.
Câu 3. Polime nào sau đây được tổng hợp bằng phản ứng trùng ngưng?
A. Poli(vinyl clorua).
B. Poliacrilonitrin.
C. Poli(metyl metacrylat).

D. Poli(etylen terephtalat).
Câu 4. Dẫn V lít khí đimetylamin vào dung dịch HCl dư, cô cạn dung dịch sau phản ứng thu được 16,789
gam muối. Giá trị của V là
A. 4,6144.
B. 4,6414.
C. 7,3024.
D. 9,2288.
Câu 5. Công thức của alanin là
A. H2NCH2CH2COOH.
B. H2NCH(CH3)COOH.
C. H2NCH2COOH.
D. H2NCH(C2H5)COOH.
Câu 6. Trong môi trường kiềm chất nào sau đây tác dụng với Cu(OH)2 cho hợp chất màu tím?
A. Ala-Ala.
B. Gly-Gly-Ala.
C. Glucozơ.
D. Tristearin.
Câu 7. Tơ tằm và tơ nilon-6,6 có chung đặc điểm nào sau đây?
A. Có cùng phân tử khối.
B. Đều thuộc loại tơ tổng hợp.
C. Đều thuộc loại tơ thiên nhiên.
D. Đều kém bền trong môi trường kiềm.
Câu 8. Hiđro hóa anđehit X thu được ancol etylic. Tên gọi của X là
A. axetanđehit.
B. fomanđehit.
C. anđehit acrylic.
D. anđehit propionic.
Câu 9. Đun nóng este nào sau đây với dung dịch NaOH thì không thu được ancol?
A. Phenyl axetat.
B. Metyl axetat.

C. Anlyl fomat.
D. Etyl propionat.
Câu 10. Chất nào sau đây không bị thủy phân trong môi trường bazơ?
A. Ala-Ala.
B. Tinh bột.
C. Tơ nilon-6.
D. Triolein.
Câu 11. Khi đốt cháy hoàn toàn một hợp chất hữu cơ thu được hỗn hợp khí CO2 và hơi nước có tỉ lệ mol
là 1 : 1. Chất này có thể lên men rượu. Chất đó là chất nào trong các chất sau?
A. Axit axetic.
B. Glucozơ.
C. Saccarozơ.
D. Fructozơ.
Câu 12. Hiđrocacbon nào sau đây làm mất màu dung dịch Br2 ở nhiệt độ thường?
A. Benzen.
B. Metan.
C. Propan.
D. Vinyl axetilen.
Câu 13. Đốt cháy hoàn một lượng C3H8 cần vừa đủ V lít O2, thu được 15,84 gam CO2. Giá trị của V là
A. 4,480.
B. 4,032.
C. 13,440.
D. 3,136.
Câu 14. Số nguyên tử hiđro trong phân tử vinyl axetat là
A. 4.
B. 8.
C. 10.
D. 6.
Câu 15. Cho các chất sau: metyl fomat, axit axetic, ancol etylic, etyl amin. Chất có độ tan trong nước nhỏ
nhất là


→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 18


A. ancol etylic.
B. axit axetic.
C. metyl fomat.
D. etyl amin.
Câu 16. Axit glutamic (axit α-aminoglutaric) là hợp chất phổ biến nhất trong các protein của các loại hạt
ngũ cốc, như trong hạt đậu chứa 43-46% axit này. Công thức phân tử của axit glutamic là
A. C5H9NO4.
B. C6H14N2O2.
C. C4H7NO4.
D. C5H11NO2.
Câu 17. Cacbohiđrat X là nguyên liệu để sản xuất tơ nhân tạo như tơ visco, tơ axetat, chế tạo thuốc súng
không khói và chế tạo phim ảnh. Cacbohiđrat X là
A. Glucozơ.
B. Xenlulozơ.
C. Saccarozơ.
D. Tinh bột.
Câu 18. Đun nóng 10,36 gam hai este (tỉ lệ mol 1 : 1) có cùng công thức phân tử C3H6O2 với dung dịch
NaOH (dư), kết thúc phản ứng thu được m gam ancol. Giá trị của m là
A. 5,46.
B. 10,92.
C. 4,48.
D. 6,44.
Câu 19. Amin nào sau đây có cùng bậc với ancol isopropylic?
A. CH3NHCH2CH3.

B. CH3CH(NH2)CH3. C. (CH3)3N.
D. CH3CH2CH2NH2.
Câu 20. Hơp chất hữu cơ nào sau đây có chứa nhóm chức anđehit (-CHO) trong phân tử?
A. Amoni axetat.
B. Glyxin.
C. Fructozơ.
D. Glucozơ.
Câu 21. Nhận định nào sau đây đúng?
A. Đốt cháy este no, mạch hở luôn thu được số mol CO2 bằng số mol H2O.
B. Este etyl propionat có mùi thơm của hoa nhài.
C. Chất béo không thuộc hợp chất este.
D. Este bị thủy phân trong môi trường axit hoặc bazơ.
Câu 22. Trong các bộ phận (củ, quả, thân,…) của một số loại cây, chứa chủ yếu một loại cacbohiđrat. Cho
bảng sau:
Bộ phận cây
Cacbohiđrat
Quả nho
Xenlulozơ
Cây mía
Glucozơ
Hạt lúa
Saccarozơ
Cây tre
Tinh bột
Cách nối tên một bộ phận của cây ở cột trái với một loại cacbohiđrat ở cột phải không đúng là
A. Cây mía  Saccarozơ.
B. Cây tre  Xenlulozơ.
C. Quả nho  Glucozơ.
D. Hạt lúa  Xenlulozơ.
Câu 23. Tại một bệnh viện cần 1000 chai glucozơ 5% (biết mỗi chai chứa 500 gam dung dịch glucozơ).

Khối lượng tinh bột cần để sản xuất ra 1000 chai glucozơ 5% là bao nhiêu kilogam? Biết hiệu suất quá trình
đạt 90%.
A. 25,00kg.
B. 12,50kg.
C. 20,25kg.
D. 22,5kg.
Câu 24. Đốt cháy hoàn toàn hai amin no, đơn chức, mạch hở cần vừa đủ 0,735 mol O2, thu được 11,7 gam
H2O. Tổng khối lượng (gam) của hai amin đem đốt là
A. 8,46 gam.
B. 6,22 gam.
C. 9,58.
D. 10,7.
Câu 25. Đun nóng este có công thức phân tử C5H10O2 với dung dịch NaOH, thu được muối và ancol bậc
2. Số đồng phân este thỏa mãn là
A. 4.
B. 1.
C. 2.
D. 3.
Câu 26. Polime X được dùng để sản xuất tơ. Khi đốt cháy X trong O2 thì sản phẩm cháy thu được có chứa
khí N2. Polime X là
A. poli(etylen terephtalat).
B. policaproamit.
C. polietilen.
D. poliisopren.
Câu 27. Đun nóng chất hữu cơ X (C5H8O4) với dung dịch NaOH (vừa đủ), kết thúc phản ứng thu được m
gam hỗn hợp muối và 11,78 gam một ancol đa chức. Giá trị của m là
A. 25,84.
B. 21,08.
C. 28,5.
D. 31,26.

Câu 28. Cho các chất sau: axetilen, axit fomic, propen, đimetyl axetilen. Số chất tác dụng với lượng dư
dung dịch AgNO3 trong NH3 tạo kết tủa là
A. 1.
B. 2.
C. 4.
D. 3.

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 19


Câu 29. Cho m gam hỗn hợp E chứa hai aminoaxit no, mạch hở tác dụng với 100 ml dung dịch HCl 1,8M,
thu được dung dịch Z. Cho toàn bộ dung dịch Z tác dụng vừa đủ với 200 ml dung dịch KOH 1,45M, cô cạn
dung dịch thu được 29,09 gam muối khan. Các phản ứng xảy ra hoàn toàn. Giá trị của m là
A. 15,68.
B. 16,14.
C. 9,52.
D. 11,5.
Câu 30. Cho 18,81 gam hỗn hợp E chứa một este đơn chức X (chứa một liên kết C=C) và một axit đơn
chức Y tác dụng vừa đủ với dung dịch NaOH, kết thúc phản ứng thu được ancol metylic và m gam một
muối duy nhất. Mặt khác, đốt cháy hoàn toàn 0,16 mol E, thu được 122a gam CO2 và 39a gam H2O. Giá
trị của m là
A. 22,56.
B. 18,80.
C. 21,60.
D. 17,28.
Câu 31. Chanh là một loài thực vật cho quả nhỏ, thuộc chi Canh chanh (danh pháp khoa học: Citrus). Chanh
có vị chua là do trong chanh chứa hàm lượng axit citric cao. Chất này là một axit hữu cơ yếu và gây ra vị
chua của chanh. Tác dụng nào không phải là của chanh?

A. Trị táo bón, tăng cường sức đề kháng.
B. Giảm cân, trị mụn, giảm lo âu.
C. Ngừa nhiệt miệng, hạ sốt, làm mềm vết chai sần.
D. Chữa bệnh đau dạ dày.
Câu 32. Hỗn hợp E gồm axit glutamic, valin và một peptit mạch hở Y (Y tạo bởi alanin và glyxin). Cho m
gam hỗn hợp E tác dụng vừa đủ với dung dịch NaOH, thu được (m + 14,26) gam muối. Đốt cháy hoàn toàn
m gam E trong khí oxi, thu được 75,24 gam CO2 và 30,06 gam H2O. Biết trong E tỉ lệ mO : mN =
8 : 3. Giá trị của m gần nhất với giá trị nào sau đây?
A. 52.
B. 42.
C. 46.
D. 44.
Câu 33. Hỗn hợp E chứa hai ankin liên tiếp nhau và một amin X no, đơn chức, mạch hở. Đốt cháy hoàn
toàn 8,82 gam hỗn hợp E cần vừa đủ 0,825 mol O2, thu được CO2 và H2O có số bằng nhau. Khối lượng lớn
nhất của amin X bằng bao nhiêu gam?
A. 2,48 gam.
B. 3,6 gam.
C. 4,72 gam.
D. 5,84 gam.
Câu 34. Túi nilon, nhựa là các polime tổng hợp có nguồn gốc từ dầu mỏ, thời gian phân hủy trong môi
trường lên đến hàng trăm năm, đang gây ô nhiễm môi trường nghiêm trọng.

Sau khi học xong chương Polime (hóa học lớp 12), giáo viên đưa ra chủ đề “Chất thải nhựa: Tác hại và
hành động của chúng ta” cho lớp cùng thảo luận. Các bạn trong lớp đưa ra các ý kiến sau:
(1) Có thể tiêu hủy túi nilon và đồ nhựa bằng cách đem đốt chúng sẽ không gây nên sự ô nhiễm môi
trường.
(2) Nếu đem đốt túi nilon và đồ làm từ nhựa có thể sinh ra chất độc, gây ô nhiễm: axit clohiđric, axit
sunfuric, đioxin ảnh hưởng đến sức khỏe cộng đồng và làm hại tầng khí quyển.
(3) Túi nilon được làm từ nhựa PE, PP có thêm các chất phụ gia vào để làm túi nilon mềm, dẻo, dai và
đặc biệt các loại phẩm nhuộm màu xanh, đỏ, vàng,...chứa kim loại như chì, cađimi là những chất gây tác

hại cho bộ não và là nguyên nhân chính gây ung thư.
(4) Cần có các vật liệu an toàn, dễ tự phân hủy hoặc bị phân hủy sinh học, thí dụ túi làm bằng vật liệu
sản xuất từ xenlulozơ.
Theo em có bao nhiêu ý kiến đúng?
A. 1.
B. 2.
C. 3.
D. 4.

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 20


Câu 35. Thủy phân hoàn toàn hỗn hợp E chứa hai triglixerit X và Y trong dung dịch NaOH (đun nóng, vừa
đủ), thu được 3 muối C15H31COONa, C17H33COONa, C17H35COONa với tỉ lệ mol tương ứng 2,5 : 1,75 : 1
và 6,44 gam glixerol. Mặt khác đốt cháy hoàn toàn 47,488 gam E cần vừa đủ a mol khí O2. Giá trị của a là
A. 4,254.
B. 5,370.
C. 4,100.
D. 4,296.
Câu 36. Nhận định nào sau đây sai?
A. Các amin đơn chức đều có số lẻ nguyên tử hiđro.
B. Nhúng giấy quỳ tím vào dung dịch axit α-aminoaxetic thấy màu quỳ tím không đổi.
C. Đưa đũa thủy tinh đã nhúng dung dịch HCl đặc tiếp xúc với đũa thủy tinh đã nhúng dung dịch CH3NH2
đặc thì không có hiện tượng gì xảy ra.
D. Anbumin của lòng trắng trứng là protein đơn giản.
Câu 37. Hỗn hợp E gồm hai este hai chức X và Y ; X mạch hở. Cho m gam E tác dụng vừa đủ với dung
dịch NaOH, cô cạn dung dịch sau phản ứng thu được 61,86 gam hỗn hợp muối khan Z gồm ba muối (trong
đó có muối natri phenolat) và 12,16 gam một ancol no duy nhất. Đốt cháy hết 61,86 gam Z cần vừa đủ

2,595 mol O2, thu được 20,7 gam H2O. Nếu đốt cháy hết m gam E cần vừa đủ 3,235 mol O2. Phần trăm
khối lượng của este Y trong E có giá trị là
A. 35,44%.
B. 35,97%.
C. 35,35%.
D. 32,24%.
Câu 38. Hỗn hợp E gồm chất X (CnH2n+2N2O6) và chất Y (CmH2m+6N2O3) có tỉ lệ mol tương ứng 7 : 8. Đốt
cháy hoàn toàn a gam E cần vừa đủ 1,265 mol O2, thu được 1,27 mol H2O. Mặt khác, cho a gam E tác dụng
hết với dung dịch KOH, cô cạn dung dịch sau phản ứng, thu được một ancol Z; một amin T đơn chức ở thể
khí và x gam hỗn hợp muối khan gồm ba muối (trong đó có muối của axit cacboxylic đa chức). Biết Z và
T có số nguyên tử cacbon khác nhau. Giá trị của x là
A. 32,53.
B. 31,55.
C. 25,63.
D. 30,57.
Câu 39. X là hợp chất hữu cơ mạch hở có công thức phân tử C6H8O4. Cho các phản ứng sau (theo đúng tỉ
lệ mol phản ứng):
0

t
X + 2NaOH 
 Z + T + H2 O

0

Ni, t
T + H2 
 T1

 2Z1 + Na2SO4

2Z + H2SO4 
Biết Z1 và T1 có cùng số nguyên tử cacbon; Z1 là hợp chất hữu cơ đơn chức. Nhận định nào sau đây đúng?
A. Tổng số nguyên tử trong T1 bằng 12.
B. Nung Z với hỗn hợp vôi tôi xút thu được ankan đơn giản nhất.
C. X không có đồng phân hình học.
D. T là hợp chất hữu cơ tạp chức, mạch hở.
Câu 40. Cho các phát biểu sau:
(a) Bột ngọt (mì chính) dùng làm gia vị nhưng nó làm tăng ion Na+ trong cơ thể làm hại nơron thần kinh
nên không lạm dụng nó.
(b) Tất cả các chất có công thức Cn(H2O)m đều là cacbohiđrat.
(c) Khi thủy phân không hoàn toàn protein thì tạo ra các chuỗi polipeptit.
(d) Thủy tinh hữu cơ (hay plexiglas) rất cứng và bền với nhiệt, nên plexiglas không phải chất dẻo.
(e) Sản phẩm của phản ứng giữa axit và ancol là este.
(f) Các ancol đa chức đều hòa tan Cu(OH)2 tạo dung dịch màu xanh lam.
Số phát biểu đúng là
A. 5.
B. 3.
C. 4.
D. 2.
--------------HẾT---------------

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 21


ĐÁP ÁN ĐỀ THI THCS – THPT NGUYỄN KHUYẾN
1. B
11. B
21. D

31. D

2. C
12. D
22. D
32. C

3. D
13. C
23. A
33. C

4. A
14. D
24. A
34. C

5. B
15. C
25. C
35. D

6. B
16. A
26. B
36. C

7. D
17. B
27. C

37. A

8. A
18. A
28. B
38. B

9. A
19. A
29. D
39. A

10. B
20. D
30. C
40. D

HƯỚNG DẪN GIẢI CHI TIẾT
Câu 23. Chọn A.
25 1
.
.162  25 (g)
180 0,9
Vậy trong 1000 chai glucozơ cần dùng lượng tinh bột là 25.1000 = 25 (kg)
Câu 24. Chọn A.
2
BT: O

 2n O2  2n CO2  n H2O  n CO2  0, 41 mol  n a min  (n H 2O  n CO2 )  0,16 mol
3

 mamin = mC + mH + mN = 8,46 (g)
Câu 25. Chọn C.
Các đồng phân thoả mãn là HCOOCH(CH3)CH2CH3; CH3COOCH(CH3)2.
Câu 27. Chọn C.
X có công thức cấu tạo là HCOO-C2H4-OOCCH3  nX = nancol = 0,19 mol
Chất rắn gồm HCOONa (0,19 mol) và CH3COONa (0,19 mol)  mmuối = 28,5 (g)
Câu 28. Chọn B.
Chất tác dụng với AgNO3 trong NH3 là axetilen, axit fomic.
Câu 29. Chọn D.
Gộp quá trình: {Amino axit và HCl} + KOH  muối + H2O
BTKL
Với n H2O  n OH  0, 29 mol 
 m E  36,5.0,18  56.0, 29  29, 09  0, 29.18  m E  11,5 (g)

Trong 1 chai glucozơ có m = 500.0,05 = 25 gam  m (C6H10O5 ) n 

Câu 30. Chọn C.
Vì thu được 1 muối duy nhất nên X và Y đều có k = 2
61
13
Khi đốt E ta có: n CO2  n H2O  n X  n Y  a  a  0,16  a  0, 264
22
6
m E  mC  m H  mO  12n CO2  2n H 2O  16.2 n E  15, 048 (g)
0, 732
BT: C

C 
 4,575  X là C3H5COOCH3 và Y là C3H5COOH
0,16

Trong 18,81 gam có 0,2 mol E  Muối thu được là C3H5COONa: 0,2 mol có m = 21,6 (g)
Câu 31. Chọn D.
Trong dạ dày của người có chứa một lượng HCl ổn định, nếu sử dụng chanh sẽ làm tăng nồng độ axit có
trong dạ dày  gây ra các vấn đề như ợ chua, đau dạ dày, viêm loét dạ dày,…..
Câu 32. Chọn C.

BTKL
COOH : a mol   40.(a  b)  14, 26  18a
a  0, 43

 CT.

(a  b)  c  1, 71  1, 67  0,5.(b  c)  b  0,12
Quy về bản chất pư: CONH : b mol   
 NH : c mol
16.(2a  b) 8
c  0,3
2




14.(b

c)
3

(độ bất bão hoà cho pư đốt cháy: n CO2  n H2O  n N2  n COOH  n CONH   n NH )
2


 m  mC  mH  mO  mN  45,42(g)

Câu 33. Chọn C.
BT: O
Ta có: n CO2  n H2O 
 3n CO2  2n O2  n CO2  0,55 mol

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 22


Đặt ankin (x mol) và amin (y mol). Độ bất bão hoà: (k1  1) x  (k 2  1  0,5t) y  n CO2  n H 2O
Với k1 = 2; k2 = 0 và t = 1  x = 1,5y mà mE = mC + mH + mN  y = 0,08  x = 0,12
BT: C

 0,12.C ankin  0, 08.C a min  0,55 (1)
Vì amin có khối lượng lớn nhất nên Camin = 3 (nếu Camin > 3 thì Cankin < 2)  C3H9N có m = 4,72 (g)
Câu 34. Chọn C.
Các ý (2), (3), (4) đúng.
Câu 35. Chọn D.
Đặt số mol các muối tương ứng là 2,5x; 1,75x và x mol
BTKL
Khi đó: 2,5x + 1,75x + x = 3nglixerol  x = 0,04 
 mE = mmuối + mglixerol – mNaOH = 59,36 (g)
Trong 47,488 gam có 0,056 mol E (gấp 1/1,25 lần so với ban đầu) và CO2: 3,032 mol (tính từ tổng số mol
C trong muối và C trong glixerol)
mà m E  mC  m H  m O  12n CO2  2n H 2O  16.6 n E  n H 2O  2,864 mol
BT: O


 n O2  4, 296 mol
Câu 37. Chọn A.
Đốt cháy E cũng chính là đốt cháy Z và ancol  n O2 (ancol)  n O2 (E)  n O2 (Z)  0, 64 mol

x  2
3n  1  x
12,16
0, 64.2
O2 


 C3H8O 2 (0,16 mol)
2
14n  2  16x 3n  1  x
n  3
Este trong E có dạng X: (RCOO)2C3H6 (0,16 mol), Y: R1(COOC6H5)2 (a mol)
Na 2CO3 : 0,16  2a (mol)
RCOONa(A) : 0,32 mol

Đốt ancol: Cn H 2n  2O x 

Đốt muối: R1 (COONa)2 : a mol
C6 H5ONa : 2a mol

 O2 : 2,595 mol

 CO2

H 2O :1,15 (mol)


BTKL
 
106.(0,16  2a)  44n CO2  124, 2 

a  0, 07
Ta có: 

BT:O

 3.(0,16  2a)  2n CO2  6a  4, 68
n CO2  2,1

 

BT:C

 0,32.CA  0,07.CB  0,14.6  2, 4  CA  CB  4
BT:H

 0,32.HA  0,07.HB  0,14.5  2,3  HA  5; HB  0

Vậy X: (C3H5COO)2C3H6 và Y: C6H5OOC-C  C-COOC6H5  %mY  35, 44%
Câu 38. Chọn B.
Đặt X CnH2n+2N2O6 (1π): 7a mol và Y CmH2m+6N2O3 (-1π): 8a mol
BTNT.O
 
 66a  2,53  1, 27  2n CO2


a  0, 01

Ta có: 

CT.
n CO2  0,96
 2.8a  n CO2  1, 27  15a


 
(độ bất bão hoà : nCO2  n H2O  n N2  (k1 1) n X  (k 2 1) n Y )

CX  8 (C8H18 N 2O6 )
BTNT.C

 0, 07.CX  0, 08.CY  0,96  
CY  5 (C5H16 N 2O3 )
Vì Y có số  = -1  Y là muối của axit cacbonic  Y: (C2H5NH3)2CO3
X tạo bởi axit đa chức  CH3OOC-CH2-COOH3NCH2COONH3C2H5
(Nếu nhóm CH2 bên axit đa chức hay bên aminoaxit thì kết quả vẫn không thay đổi).
Muối thu được gồm K2CO3: 0,08 mol, CH2(COOK)2 : 0,07 mol, H2NCH2COOK: 0,07 mol  x  31,55
Câu 39. Chọn D.
Vì Z1 và T1 có cùng số C ⇒ Z và T cùng số C và đều có 3C
⇒ X là CH3CH=CHOOC-CH2-COOH  Z là CH2(COONa)2.
T là CH3CH2CHO ⇒ T1 là CH3CH2CH2OH.
A. Đúng, Tổng số nguyên tử trong T1 = 3 + 8 + 1 = 12.

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 23



B. Sai, Nung Z với hỗn hợp vôi tôi xút thu được ankan đơn giản nhất.
C. Sai, X không có đồng phân hình học.
D. Sai, T là anđehit no, đơn chức, mạch hở.
Câu 40. Chọn D.
(b) Sai, Metyl fomat: C2(H2O)2 không thuộc loại cacbohiđrat.
(d) Sai, Thủy tinh hữu cơ (hay plexiglas) là chất dẻo.
(e) Sai, Sản phẩm của phản ứng giữa axit và anol có thể thu được các hợp chất hữu cơ tạp chức. Ví dụ:
o

H 2SO 4 ,t
 CH3COO-CH2-CH2-OH + H2O
CH3COOH + HO-CH2-CH2-OH 
(f) Sai, Các ancol đa chức (có ít nhất 2 nhóm –OH kề nhau) đều hòa tan Cu(OH)2 tạo dung dịch màu xanh
lam.

--------------HẾT---------------

→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 24


SỞ GIÁO DỤC VÀ ĐÀO TẠO
HÀ NỘI

ĐỀ THI THỬ THPT QUỐC GIA LẦN 1
THCS - THPT M.V LÔMÔXỐP
Bài thi: KHOA HỌC TỰ NHIÊN
Môn thi thành phần: HOÁ HỌC
Thời gian làm bài: 50 phút, không kể thời gian phát đề


ĐỀ CHÍNH THỨC
(Đề có 04 trang)
Họ, tên thí sinh: .....................................................................
Mã đề thi 110
Số báo danh: ..........................................................................
* Cho biết nguyên tử khối của các nguyên tố:
H = 1; He = 4; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; S = 32; Cl = 35,5; K = 39; Ca = 40; Cr
= 52; Mn = 55; Fe = 56; Cu = 64; Zn = 65; Br = 80; Ag = 108; Ba = 137.
* Các thể tích khí đều đo ở điều kiện tiêu chuẩn, giả thiết các khí sinh ra không tan trong nước.
Câu 1: Chất nào sau đây tác dụng với dung dịch HNO3 (đặc, nóng) không sinh ra chất khí?
A. Fe2O3.
B. FeO.
C. Fe3O4.
D. Fe(OH)2.
Câu 2: Phản ứng hóa học giữa CH3OH và C2H5COOH (xúc tác H2SO4 đặc, đun nóng) được gọi là phản
ứng
A. xà phòng hóa.
B. este hóa.
C. trùng hợp.
D. trùng ngưng.
Câu 3: Khí nào sau đây có khả năng làm mất màu nước brom?
A. NO.
B. H2S.
C. CO2.
D. H2.
Câu 4: Axit fomic có trong nọc kiến. Khi bị kiến cắn, nên bôi chất nào sau đây vào vết thương để giảm
sưng tấy?
A. Nước vôi.
B. Giấm ăn.

C. Nước.
D. Muối ăn.
Câu 5: KHCO3 phản ứng được với dung dịch nào sau đây ở nhiệt độ thường?
A. NaNO3.
B. HCl.
C. Ba(NO3)2.
D. K2SO4.
Câu 6: Ở trạng thái cơ bản, cấu hình electron lớp ngoài cùng của nguyên tử Na là
A. 2s1.
B. 3s1.
C. 4s1.
D. 3p1.
Câu 7: Kim loại Mg tác dụng được với chất (hoặc dung dịch) nào sau đây?
A. Ba(OH)2.
B. NaCl.
C. HCl loãng.
D. Mg(NO3)2.
Câu 8: Trong các hợp chất, số oxi hóa cao nhất của ntiơ là
A. +2.
B. +3.
C. +4.
D. +5.
Câu 9: Chất nào sau đây không có khả năng tham gia phản ứng trùng hợp?
A. Isopren
B. Stiren.
C. Propen.
D. Toluen.
Câu 10: Axit cacboxylic nào sau đây có mạch cacbon phân nhánh?
A. Axit axetic.
B. Axit oxalic.

C. Axit isobutiric.
D. Axit acrylic.
Câu 11: Phương trình ion rút gọn của phản ứng xảy ra giữa NaHCO3 và HCl trong dung dịch
 H 2O.
A. H +  OH  
B. 2H+  CO23  
 CO2  + H2O.
C. H+  HCO3 
 CO2  + H2O.

D. HCl  HCO3 
 CO2  + H2O + Cl .

Câu 12: So với các hợp chất vô cơ, các hợp chất hữu cơ thường có
A. độ bền nhiệt cao hơn.
B. độ tan trong nước lớn hơn.
C. nhiệt độ nóng chảy thấp hơn.
D. khả năng tham gia phản ứng với tốc độ lớn hơn.
Câu 13: Cho 11,28 gam phenol tác dụng hết với nước brom dư, khối lượng kết tủa 2,4,6-tribromphenol thu
được là
A. 39,72.
B. 30,24.
C. 30,48.
D. 20,08.
Câu 14: Đốt cháy hoàn toàn 9,6 gam kim loại M (có hóa trị không đổi) trong khí Cl2 dư, thu được 26,64
gam muối. Kim loại M là
A. K.
B. Ca.
C. Mg.
D. Al.


→ Group Đề thi + Tài liệu MIỄN PHÍ | https://www.facebook.com/groups/TYHH2020/

TYHH | Page 25


Xem Thêm

×